EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H26O2 |
| Net Charge | 0 |
| Average Mass | 274.404 |
| Monoisotopic Mass | 274.19328 |
| SMILES | CC/C=C\C/C=C\C/C=C\CC#CCCCCC(=O)O |
| InChI | InChI=1S/C18H26O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-4,6-7,9-10H,2,5,8,11,14-17H2,1H3,(H,19,20)/b4-3-,7-6-,10-9- |
| InChIKey | UXMMIMGEKFYPFK-PDBXOOCHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dicranum scoparium (ncbitaxon:3222) | - | PubMed (8377015) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 1.13.11.33 (arachidonate 15-lipoxygenase) inhibitor A lipoxygenase inhibitor that interferes with the action of arachidonate 15-lipoxygenase (EC 1.13.11.33). antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (9Z,12Z,15Z)-octadeca-9,12,15-trien-6-ynoic acid (CHEBI:65768) has role antibacterial agent (CHEBI:33282) |
| (9Z,12Z,15Z)-octadeca-9,12,15-trien-6-ynoic acid (CHEBI:65768) has role EC 1.13.11.33 (arachidonate 15-lipoxygenase) inhibitor (CHEBI:64996) |
| (9Z,12Z,15Z)-octadeca-9,12,15-trien-6-ynoic acid (CHEBI:65768) has role metabolite (CHEBI:25212) |
| (9Z,12Z,15Z)-octadeca-9,12,15-trien-6-ynoic acid (CHEBI:65768) is a acetylenic fatty acid (CHEBI:25380) |
| (9Z,12Z,15Z)-octadeca-9,12,15-trien-6-ynoic acid (CHEBI:65768) is a long-chain fatty acid (CHEBI:15904) |
| (9Z,12Z,15Z)-octadeca-9,12,15-trien-6-ynoic acid (CHEBI:65768) is a straight-chain fatty acid (CHEBI:59202) |
| (9Z,12Z,15Z)-octadeca-9,12,15-trien-6-ynoic acid (CHEBI:65768) is a trienoic fatty acid (CHEBI:73155) |
| Incoming Relation(s) |
| (9Z,12Z,15Z)-octadeca-9,12,15-trien-6-ynoyl-containing glycerolipid (CHEBI:88244) has functional parent (9Z,12Z,15Z)-octadeca-9,12,15-trien-6-ynoic acid (CHEBI:65768) |
| (9Z,12Z,15Z)-octadeca-9,12,15-trien-6-ynoyl group (CHEBI:86292) is substituent group from (9Z,12Z,15Z)-octadeca-9,12,15-trien-6-ynoic acid (CHEBI:65768) |
| IUPAC Name |
|---|
| (9Z,12Z,15Z)-octadeca-9,12,15-trien-6-ynoic acid |
| Synonym | Source |
|---|---|
| dicranin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4432637 | Reaxys |
| CAS:61481-30-9 | ChemIDplus |
| Citations |
|---|