EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H26O2 |
| Net Charge | 0 |
| Average Mass | 274.404 |
| Monoisotopic Mass | 274.19328 |
| SMILES | CC/C=C\C/C=C\C/C=C\CC#CCCCCC(=O)O |
| InChI | InChI=1S/C18H26O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-4,6-7,9-10H,2,5,8,11,14-17H2,1H3,(H,19,20)/b4-3-,7-6-,10-9- |
| InChIKey | UXMMIMGEKFYPFK-PDBXOOCHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dicranum scoparium (ncbitaxon:3222) | - | PubMed (8377015) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 1.13.11.33 (arachidonate 15-lipoxygenase) inhibitor A lipoxygenase inhibitor that interferes with the action of arachidonate 15-lipoxygenase (EC 1.13.11.33). antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (9Z,12Z,15Z)-octadeca-9,12,15-trien-6-ynoic acid (CHEBI:65768) has role antibacterial agent (CHEBI:33282) |
| (9Z,12Z,15Z)-octadeca-9,12,15-trien-6-ynoic acid (CHEBI:65768) has role EC 1.13.11.33 (arachidonate 15-lipoxygenase) inhibitor (CHEBI:64996) |
| (9Z,12Z,15Z)-octadeca-9,12,15-trien-6-ynoic acid (CHEBI:65768) has role metabolite (CHEBI:25212) |
| (9Z,12Z,15Z)-octadeca-9,12,15-trien-6-ynoic acid (CHEBI:65768) is a acetylenic fatty acid (CHEBI:25380) |
| (9Z,12Z,15Z)-octadeca-9,12,15-trien-6-ynoic acid (CHEBI:65768) is a long-chain fatty acid (CHEBI:15904) |
| (9Z,12Z,15Z)-octadeca-9,12,15-trien-6-ynoic acid (CHEBI:65768) is a straight-chain fatty acid (CHEBI:59202) |
| (9Z,12Z,15Z)-octadeca-9,12,15-trien-6-ynoic acid (CHEBI:65768) is a trienoic fatty acid (CHEBI:73155) |
| Incoming Relation(s) |
| (9Z,12Z,15Z)-octadeca-9,12,15-trien-6-ynoyl-containing glycerolipid (CHEBI:88244) has functional parent (9Z,12Z,15Z)-octadeca-9,12,15-trien-6-ynoic acid (CHEBI:65768) |
| (9Z,12Z,15Z)-octadeca-9,12,15-trien-6-ynoyl group (CHEBI:86292) is substituent group from (9Z,12Z,15Z)-octadeca-9,12,15-trien-6-ynoic acid (CHEBI:65768) |
| IUPAC Name |
|---|
| (9Z,12Z,15Z)-octadeca-9,12,15-trien-6-ynoic acid |
| Synonym | Source |
|---|---|
| dicranin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4432637 | Reaxys |
| CAS:61481-30-9 | ChemIDplus |
| Citations |
|---|