EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H48O13 |
| Net Charge | 0 |
| Average Mass | 664.745 |
| Monoisotopic Mass | 664.30949 |
| SMILES | CCCCOC(=O)CCc1cc(OC)c(O)c(-c2cc(CCC(=O)OCCCC)cc(OC)c2O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C34H48O13/c1-5-7-13-44-27(36)11-9-20-15-22(29(38)24(17-20)42-3)23-16-21(10-12-28(37)45-14-8-6-2)18-25(43-4)33(23)47-34-32(41)31(40)30(39)26(19-35)46-34/h15-18,26,30-32,34-35,38-41H,5-14,19H2,1-4H3/t26-,30-,31+,32-,34+/m1/s1 |
| InChIKey | VMLJWIKVMRPCIF-GVQAODHLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stellaria dichotoma var. lanceolata (IPNI:50920984-1) | root (BTO:0001188) | PubMed (15467234) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-allergic agent A drug used to treat allergic reactions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dichotomoside D (CHEBI:65767) has role anti-allergic agent (CHEBI:50857) |
| dichotomoside D (CHEBI:65767) has role plant metabolite (CHEBI:76924) |
| dichotomoside D (CHEBI:65767) is a biphenyls (CHEBI:22888) |
| dichotomoside D (CHEBI:65767) is a carboxylic ester (CHEBI:33308) |
| dichotomoside D (CHEBI:65767) is a guaiacols (CHEBI:134251) |
| dichotomoside D (CHEBI:65767) is a neolignan (CHEBI:25497) |
| dichotomoside D (CHEBI:65767) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| dibutyl 3,3'-[6-(β-D-glucopyranosyloxy)-6'-hydroxy-5,5'-dimethoxybiphenyl-3,3'-diyl]dipropanoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9891311 | Reaxys |
| Citations |
|---|