EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H22O4 |
| Net Charge | 0 |
| Average Mass | 278.348 |
| Monoisotopic Mass | 278.15181 |
| SMILES | CCCCOc1ccc(-c2ccc(OCCCC)o2)o1 |
| InChI | InChI=1S/C16H22O4/c1-3-5-11-17-15-9-7-13(19-15)14-8-10-16(20-14)18-12-6-4-2/h7-10H,3-6,11-12H2,1-2H3 |
| InChIKey | BQFASOONPNRMGH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chrysanthemum coronarium (ncbitaxon:99038) | aerial part (BTO:0001658) | PubMed (18481011) |
| Roles Classification |
|---|
| Biological Roles: | EC 2.3.1.26 (sterol O-acyltransferase) inhibitor An EC 2.3.1.* (acyltransferase transferring other than amino-acyl group) inhibitor that interferes with the action of acyl-CoA:cholesterol acyltransferase (EC 2.3.1.26). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,5'-dibutoxy-2,2'-bifuran (CHEBI:65763) has role EC 2.3.1.26 (sterol O-acyltransferase) inhibitor (CHEBI:64696) |
| 5,5'-dibutoxy-2,2'-bifuran (CHEBI:65763) has role metabolite (CHEBI:25212) |
| 5,5'-dibutoxy-2,2'-bifuran (CHEBI:65763) is a ether (CHEBI:25698) |
| 5,5'-dibutoxy-2,2'-bifuran (CHEBI:65763) is a furans (CHEBI:24129) |
| 5,5'-dibutoxy-2,2'-bifuran (CHEBI:65763) is a ring assembly (CHEBI:36820) |
| IUPAC Name |
|---|
| 5,5'-dibutoxy-2,2'-bifuran |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20775042 | Reaxys |
| Citations |
|---|