EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11Br2N5O |
| Net Charge | 0 |
| Average Mass | 389.051 |
| Monoisotopic Mass | 386.93303 |
| SMILES | [H][C@@]12NC(N)=N[C@@]13CCCN3C(=O)c1cc(Br)c(Br)n12 |
| InChI | InChI=1S/C11H11Br2N5O/c12-5-4-6-8(19)17-3-1-2-11(17)9(15-10(14)16-11)18(6)7(5)13/h4,9H,1-3H2,(H3,14,15,16)/t9-,11+/m0/s1 |
| InChIKey | MKCFBJDWCJAOTN-GXSJLCMTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acanthella costata (WORMS:165653) | - | PubMed (19243956) | |
| Phakellia flabellata (WORMS:192925) | - | DOI (10.1021/jo00445a028) |
| Roles Classification |
|---|
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-dibromophakellin (CHEBI:65762) has role animal metabolite (CHEBI:75767) |
| (−)-dibromophakellin (CHEBI:65762) has role marine metabolite (CHEBI:76507) |
| (−)-dibromophakellin (CHEBI:65762) has role α-adrenergic agonist (CHEBI:35569) |
| (−)-dibromophakellin (CHEBI:65762) is a alkaloid (CHEBI:22315) |
| (−)-dibromophakellin (CHEBI:65762) is a guanidines (CHEBI:24436) |
| (−)-dibromophakellin (CHEBI:65762) is a organobromine compound (CHEBI:37141) |
| IUPAC Name |
|---|
| (3aR,12aS)-2-amino-10,11-dibromo-1,5,6,12a-tetrahydro-4H,8H-imidazo[4,5-b]dipyrrolo[1,2-a:1',2'-d]pyrazin-8-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8008418 | Reaxys |
| Citations |
|---|