EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C66H104O34 |
| Net Charge | 0 |
| Average Mass | 1441.524 |
| Monoisotopic Mass | 1440.64090 |
| SMILES | [H][C@@]1(O[C@@H]2[C@@H](O)[C@H](OC(=O)[C@]34CCC(C)(C)C[C@@]3([H])C3=CC[C@]5([H])[C@@]6(C)CC[C@H](O)[C@@](C)(C(=O)O[C@@H]7O[C@H](CO)[C@@H](O)[C@H](O)[C@H]7O)[C@]6([H])CC[C@@]5(C)[C@]3(C)CC4)O[C@H](CO[C@@H]3O[C@H](COC(=O)C[C@@](C)(O)CC(=O)O)[C@@H](O)[C@H](O)[C@H]3O[C@]3([H])O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C66H104O34/c1-60(2)14-16-66(17-15-63(5)26(27(66)18-60)8-9-33-62(4)12-11-35(70)65(7,34(62)10-13-64(33,63)6)58(87)99-55-49(85)45(81)40(76)30(23-69)94-55)59(88)100-56-50(86)51(97-53-47(83)43(79)38(74)28(21-67)92-53)42(78)32(95-56)25-91-57-52(98-54-48(84)44(80)39(75)29(22-68)93-54)46(82)41(77)31(96-57)24-90-37(73)20-61(3,89)19-36(71)72/h8,27-35,38-57,67-70,74-86,89H,9-25H2,1-7H3,(H,71,72)/t27-,28+,29+,30+,31+,32+,33+,34+,35-,38+,39+,40+,41+,42+,43-,44-,45-,46-,47+,48+,49+,50+,51-,52+,53-,54-,55-,56-,57+,61-,62+,63+,64+,65-,66-/m0/s1 |
| InChIKey | AIBXBOWACXMYQP-SOZRLZBRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dianthus versicolor (ncbitaxon:746817) | whole plant (BTO:0001461) | PubMed (19290648) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dianversicoside C (CHEBI:65757) has functional parent 3-hydroxy-3-methylglutaric acid (CHEBI:16831) |
| dianversicoside C (CHEBI:65757) has functional parent gypsogenic acid (CHEBI:71531) |
| dianversicoside C (CHEBI:65757) has parent hydride oleanane (CHEBI:36481) |
| dianversicoside C (CHEBI:65757) has role antineoplastic agent (CHEBI:35610) |
| dianversicoside C (CHEBI:65757) has role plant metabolite (CHEBI:76924) |
| dianversicoside C (CHEBI:65757) is a carboxylic ester (CHEBI:33308) |
| dianversicoside C (CHEBI:65757) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| dianversicoside C (CHEBI:65757) is a pentacyclic triterpenoid (CHEBI:25872) |
| dianversicoside C (CHEBI:65757) is a triterpenoid saponin (CHEBI:61778) |
| Synonym | Source |
|---|---|
| 23-O-β-D-glucopyranosyl-3β-hydroxyolean-12-en-23α,28β-dioic acid 28-O-[β-D-glucopyranosyl(1→3)]{[β-D-glucopyranosyl(1→2)][β-D-6-O-((3S)-3-hydroxy-3-methylglutaryl)glucopyranosyl(1→6)]}-β-D-glucopyranoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19700160 | Reaxys |
| Citations |
|---|