EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O5 |
| Net Charge | 0 |
| Average Mass | 338.359 |
| Monoisotopic Mass | 338.11542 |
| SMILES | CC1(C)C=Cc2c(O)ccc(C3COc4cc(O)ccc4C3=O)c2O1 |
| InChI | InChI=1S/C20H18O5/c1-20(2)8-7-13-16(22)6-5-12(19(13)25-20)15-10-24-17-9-11(21)3-4-14(17)18(15)23/h3-9,15,21-22H,10H2,1-2H3 |
| InChIKey | NUHWTADXTBESTA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Erythrina lysistemon (ncbitaxon:347910) | root (BTO:0001188) | PubMed (9170286) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-deoxyglyasperin F (CHEBI:65746) has role anti-HIV agent (CHEBI:64946) |
| 5-deoxyglyasperin F (CHEBI:65746) has role metabolite (CHEBI:25212) |
| 5-deoxyglyasperin F (CHEBI:65746) is a hydroxyisoflavanone (CHEBI:72739) |
| 5-deoxyglyasperin F (CHEBI:65746) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 5',7-dihydroxy-2',2'-dimethyl-2,3-dihydro-2'H,4H-3,8'-bichromen-4-one |
| Citations |
|---|