EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16O5 |
| Net Charge | 0 |
| Average Mass | 276.288 |
| Monoisotopic Mass | 276.09977 |
| SMILES | COc1cc(CCc2ccc(O)c(O)c2)cc(O)c1O |
| InChI | InChI=1S/C15H16O5/c1-20-14-8-10(7-13(18)15(14)19)3-2-9-4-5-11(16)12(17)6-9/h4-8,16-19H,2-3H2,1H3 |
| InChIKey | LQWUHEDAVONVEF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dendrobium candidum (ncbitaxon:431188) | stem (BTO:0001300) | PubMed (19182417) |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dendrocandin E (CHEBI:65745) has parent hydride 1,2-dihydrostilbene (CHEBI:34047) |
| dendrocandin E (CHEBI:65745) has role metabolite (CHEBI:25212) |
| dendrocandin E (CHEBI:65745) has role radical scavenger (CHEBI:48578) |
| dendrocandin E (CHEBI:65745) is a catechols (CHEBI:33566) |
| dendrocandin E (CHEBI:65745) is a diphenylethane (CHEBI:51571) |
| dendrocandin E (CHEBI:65745) is a methoxybenzenes (CHEBI:51683) |
| IUPAC Name |
|---|
| 5-[2-(3,4-dihydroxyphenyl)ethyl]-3-methoxybenzene-1,2-diol |
| Synonym | Source |
|---|---|
| 3,3',4,4'-tetrahydroxy-5-methoxybibenzyl | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19477772 | Reaxys |
| Citations |
|---|