EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18O5 |
| Net Charge | 0 |
| Average Mass | 290.315 |
| Monoisotopic Mass | 290.11542 |
| SMILES | COc1cc([C@H](Cc2ccc(O)cc2)OC)cc(O)c1O |
| InChI | InChI=1S/C16H18O5/c1-20-14(7-10-3-5-12(17)6-4-10)11-8-13(18)16(19)15(9-11)21-2/h3-6,8-9,14,17-19H,7H2,1-2H3/t14-/m0/s1 |
| InChIKey | NETURQQBHBZIMJ-AWEZNQCLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dendrobium candidum (ncbitaxon:431188) | stem (BTO:0001300) | PubMed (19182417) |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dendrocandin C (CHEBI:65743) has parent hydride 1,2-dihydrostilbene (CHEBI:34047) |
| dendrocandin C (CHEBI:65743) has role metabolite (CHEBI:25212) |
| dendrocandin C (CHEBI:65743) has role radical scavenger (CHEBI:48578) |
| dendrocandin C (CHEBI:65743) is a catechols (CHEBI:33566) |
| dendrocandin C (CHEBI:65743) is a diphenylethane (CHEBI:51571) |
| dendrocandin C (CHEBI:65743) is a methoxybenzenes (CHEBI:51683) |
| IUPAC Name |
|---|
| 5-[(1S)-2-(4-hydroxyphenyl)-1-methoxyethyl]-3-methoxybenzene-1,2-diol |
| Synonym | Source |
|---|---|
| (S)-3,4,4'-trihydroxy-5,α-dimethoxybibenzyl | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19477771 | Reaxys |
| Citations |
|---|