EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H36N2O4 |
| Net Charge | 0 |
| Average Mass | 452.595 |
| Monoisotopic Mass | 452.26751 |
| SMILES | [H][C@]1(C[C@]2([H])NCCc3cc(O)c(O)cc32)C[C@@]2([H])c3cc(OC)c(OC)cc3CCN2C[C@@H]1CC |
| InChI | InChI=1S/C27H36N2O4/c1-4-16-15-29-8-6-18-12-26(32-2)27(33-3)14-21(18)23(29)10-19(16)9-22-20-13-25(31)24(30)11-17(20)5-7-28-22/h11-14,16,19,22-23,28,30-31H,4-10,15H2,1-3H3/t16-,19-,22-,23-/m0/s1 |
| InChIKey | HGQNZTBYUKKJLH-CQOCVSQPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Psychotria klugii (IPNI:212953-2) | whole plant (BTO:0001461) | PubMed (12880315) |
| Roles Classification |
|---|
| Biological Roles: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7'-O-demethylisocephaeline (CHEBI:65740) has role antileishmanial agent (CHEBI:70868) |
| 7'-O-demethylisocephaeline (CHEBI:65740) has role metabolite (CHEBI:25212) |
| 7'-O-demethylisocephaeline (CHEBI:65740) is a aromatic ether (CHEBI:35618) |
| 7'-O-demethylisocephaeline (CHEBI:65740) is a isoquinoline alkaloid (CHEBI:24921) |
| 7'-O-demethylisocephaeline (CHEBI:65740) is a isoquinolines (CHEBI:24922) |
| 7'-O-demethylisocephaeline (CHEBI:65740) is a polyphenol (CHEBI:26195) |
| 7'-O-demethylisocephaeline (CHEBI:65740) is a pyridoisoquinoline (CHEBI:61692) |
| IUPAC Name |
|---|
| (1'β)-10,11-dimethoxyemetan-6',7'-diol |
| Manual Xrefs | Databases |
|---|---|
| 9060170 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9674985 | Reaxys |
| Citations |
|---|