EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O5 |
| Net Charge | 0 |
| Average Mass | 338.359 |
| Monoisotopic Mass | 338.11542 |
| SMILES | COc1cc(/C=C/C(=O)CC(=O)/C=C/c2ccc(O)cc2)ccc1O |
| InChI | InChI=1S/C20H18O5/c1-25-20-12-15(6-11-19(20)24)5-10-18(23)13-17(22)9-4-14-2-7-16(21)8-3-14/h2-12,21,24H,13H2,1H3/b9-4+,10-5+ |
| InChIKey | HJTVQHVGMGKONQ-LUZURFALSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Curcuma zedoaria (ncbitaxon:136224) | - | PubMed (9868158) | |
| Etlingera elatior (ncbitaxon:188493) | rhizome (BTO:0001181) | PubMed (15730265) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| demethoxycurcumin (CHEBI:65737) has role anti-inflammatory agent (CHEBI:67079) |
| demethoxycurcumin (CHEBI:65737) has role antineoplastic agent (CHEBI:35610) |
| demethoxycurcumin (CHEBI:65737) has role metabolite (CHEBI:25212) |
| demethoxycurcumin (CHEBI:65737) is a diarylheptanoid (CHEBI:78802) |
| demethoxycurcumin (CHEBI:65737) is a enone (CHEBI:51689) |
| demethoxycurcumin (CHEBI:65737) is a polyphenol (CHEBI:26195) |
| demethoxycurcumin (CHEBI:65737) is a β-diketone (CHEBI:67265) |
| IUPAC Name |
|---|
| (1E,6E)-1-(4-hydroxy-3-methoxyphenyl)-7-(4-hydroxyphenyl)hepta-1,6-diene-3,5-dione |
| Synonyms | Source |
|---|---|
| (1E,6E)-1-(4-hydroxy-3-methoxyphenyl)-7-(4-hydroxyphenyl)-1,6-heptadiene-3,5-dione | ChEBI |
| (1E,6E)-1-(4-hydroxy-3-methoxyphenyl)-7-(4-hydroxyphenyl)-hepta-1,6-diene-3,5-dione | ChEBI |
| 4-hydroxycinnamoyl(feroyl)methane | ChemIDplus |
| 4-hydroxycinnamoyl(feruloyl)methane | ChEBI |
| BHCFM | ChemIDplus |
| curcuminII | ChEBI |
| UniProt Name | Source |
|---|---|
| demethoxycurcumin | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5589254 | Reaxys |
| CAS:22608-11-3 | KEGG COMPOUND |
| CAS:24939-17-1 | ChemIDplus |
| Citations |
|---|