EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H30O8 |
| Net Charge | 0 |
| Average Mass | 566.606 |
| Monoisotopic Mass | 566.19407 |
| SMILES | COc1cc(C2Oc3c(OC)cc(/C=C/COC(=O)c4ccccc4)cc3C2COC(=O)c2ccccc2)ccc1O |
| InChI | InChI=1S/C34H30O8/c1-38-29-20-25(15-16-28(29)35)31-27(21-41-34(37)24-13-7-4-8-14-24)26-18-22(19-30(39-2)32(26)42-31)10-9-17-40-33(36)23-11-5-3-6-12-23/h3-16,18-20,27,31,35H,17,21H2,1-2H3/b10-9+ |
| InChIKey | VSDDOTKKJQUPSV-MDZDMXLPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euterpe precatoria (ncbitaxon:154480) | root (BTO:0001188) | PubMed (12502338) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. |
| Application: | antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dehydrodiconiferyl dibenzoate (CHEBI:65735) has role antiplasmodial drug (CHEBI:64915) |
| dehydrodiconiferyl dibenzoate (CHEBI:65735) has role metabolite (CHEBI:25212) |
| dehydrodiconiferyl dibenzoate (CHEBI:65735) is a 1-benzofurans (CHEBI:38830) |
| dehydrodiconiferyl dibenzoate (CHEBI:65735) is a aromatic ether (CHEBI:35618) |
| dehydrodiconiferyl dibenzoate (CHEBI:65735) is a benzoate ester (CHEBI:36054) |
| dehydrodiconiferyl dibenzoate (CHEBI:65735) is a lignan (CHEBI:25036) |
| dehydrodiconiferyl dibenzoate (CHEBI:65735) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| (2E)-3-{3-[(benzoyloxy)methyl]-2-(4-hydroxy-3-methoxyphenyl)-7-methoxy-2,3-dihydro-1-benzofuran-5-yl}prop-2-en-1-yl benzoate |
| Synonym | Source |
|---|---|
| rac-(2E)-3-{3-[(benzoyloxy)methyl]-2-(4-hydroxy-3-methoxyphenyl)-7-methoxy-2,3-dihydro-1-benzofuran-5-yl}prop-2-en-1-yl benzoate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9454646 | Reaxys |
| Citations |
|---|