EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24O8 |
| Net Charge | 0 |
| Average Mass | 392.404 |
| Monoisotopic Mass | 392.14712 |
| SMILES | C/C=C/c1cc(=O)c2c(C)cc(OC)c([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c2o1 |
| InChI | InChI=1S/C20H24O8/c1-4-5-10-7-11(22)14-9(2)6-12(26-3)15(19(14)27-10)20-18(25)17(24)16(23)13(8-21)28-20/h4-7,13,16-18,20-21,23-25H,8H2,1-3H3/b5-4+/t13-,16-,17+,18-,20+/m1/s1 |
| InChIKey | MLEBNHHZBNKVMI-VBCQJRRHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aloe vera (ncbitaxon:34199) | whole plant (BTO:0001461) | PubMed (18543151) |
| Roles Classification |
|---|
| Biological Roles: | EC 3.4.23.46 (memapsin 2) inhibitor An EC 3.4.23.* (aspartic endopeptidase) inhibitor that interferes with the activity of memapsin 2 (EC 3.4.23.46). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| C-2'-decoumaroyl-aloeresin G (CHEBI:65730) has role EC 3.4.23.46 (memapsin 2) inhibitor (CHEBI:74925) |
| C-2'-decoumaroyl-aloeresin G (CHEBI:65730) has role plant metabolite (CHEBI:76924) |
| C-2'-decoumaroyl-aloeresin G (CHEBI:65730) is a C-glycosyl compound (CHEBI:20857) |
| C-2'-decoumaroyl-aloeresin G (CHEBI:65730) is a aromatic ether (CHEBI:35618) |
| C-2'-decoumaroyl-aloeresin G (CHEBI:65730) is a chromones (CHEBI:23238) |
| IUPAC Name |
|---|
| (1S)-1,5-anhydro-1-{7-methoxy-5-methyl-4-oxo-2-[(1E)-prop-1-en-1-yl]-4H-chromen-8-yl}-D-glucitol |
| Synonym | Source |
|---|---|
| 2-(E)-propenyl-7-methoxy-8-C-beta-D-glucopyranosyl-5-methyl-chromone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15851970 | Reaxys |
| Citations |
|---|