EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C45H56Cl2N2O10 |
| Net Charge | 0 |
| Average Mass | 855.853 |
| Monoisotopic Mass | 854.33120 |
| SMILES | [H][C@]12C=C[C@@]3([H])C/C=C/C/C(C)=C/[C@@]4(C)C=C(C(=O)O)[C@@H](CC)C[C@]45OC(=O)C(=C5O)C(=O)[C@@]3(CC)[C@]1([H])CC[C@H](C)[C@]2([H])O[C@H]1C[C@H](O)[C@H](NC(=O)c2nc(Cl)cc2Cl)[C@@H](C)O1 |
| InChI | InChI=1S/C45H56Cl2N2O10/c1-7-25-20-45-39(52)34(42(56)59-45)38(51)44(8-2)26(12-10-9-11-22(3)19-43(45,6)21-28(25)41(54)55)14-15-27-29(44)16-13-23(4)37(27)58-33-18-31(50)35(24(5)57-33)49-40(53)36-30(46)17-32(47)48-36/h9-10,14-15,17,19,21,23-27,29,31,33,35,37,48,50,52H,7-8,11-13,16,18,20H2,1-6H3,(H,49,53)(H,54,55)/b10-9+,22-19+/t23-,24+,25-,26+,27-,29+,31-,33-,35+,37-,43-,44+,45+/m0/s1 |
| InChIKey | OKYWSSBYCHUWKT-ZJOLZETKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actinomadura (ncbitaxon:1988) | - | PubMed (10726925) | Strain: MK73 NF4 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| decatromicin B (CHEBI:65729) has role antibacterial agent (CHEBI:33282) |
| decatromicin B (CHEBI:65729) has role metabolite (CHEBI:25212) |
| decatromicin B (CHEBI:65729) is a amide (CHEBI:32988) |
| decatromicin B (CHEBI:65729) is a carbohydrate-containing antibiotic (CHEBI:23007) |
| decatromicin B (CHEBI:65729) is a enol (CHEBI:33823) |
| decatromicin B (CHEBI:65729) is a macrocycle (CHEBI:51026) |
| decatromicin B (CHEBI:65729) is a monocarboxylic acid (CHEBI:25384) |
| decatromicin B (CHEBI:65729) is a organochlorine compound (CHEBI:36683) |
| decatromicin B (CHEBI:65729) is a oxaspiro compound (CHEBI:37948) |
| decatromicin B (CHEBI:65729) is a pyrroles (CHEBI:26455) |
| decatromicin B (CHEBI:65729) is a trideoxyhexose derivative (CHEBI:63349) |
| decatromicin B (CHEBI:65729) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3S,4S,4aS,6aR,8E,11E,12aS,15S,16aS,20aR,20bR)-15,20a-diethyl-21-hydroxy-3,11,12a-trimethyl-18,20-dioxo-4-[(2,4,6-trideoxy-4-{[(3,5-dichloro-1H-pyrrol-2-yl)carbonyl]amino}-β-D-ribo-hexopyranosyl)oxy]-1,2,3,4,4a,6a,7,10,12a,15,16,20,20a,20b-tetradecahydro-16a,19-(metheno)benzo[b]naphtho[2,1-j]oxacyclotetradecine-14(18H)-carboxylic acid |
| Citations |
|---|