EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C45H57ClN2O10 |
| Net Charge | 0 |
| Average Mass | 821.408 |
| Monoisotopic Mass | 820.37017 |
| SMILES | [H][C@]12C=C[C@@]3([H])C/C=C/C/C(C)=C/[C@@]4(C)C=C(C(=O)O)[C@@H](CC)C[C@]45OC(=O)C(=C5O)C(=O)[C@@]3(CC)[C@]1([H])CC[C@H](C)[C@]2([H])O[C@H]1C[C@@H](O)[C@H](NC(=O)c2nccc2Cl)[C@@H](C)O1 |
| InChI | InChI=1S/C45H57ClN2O10/c1-7-26-21-45-39(51)34(42(55)58-45)38(50)44(8-2)27(12-10-9-11-23(3)20-43(45,6)22-29(26)41(53)54)14-15-28-30(44)16-13-24(4)37(28)57-33-19-32(49)35(25(5)56-33)48-40(52)36-31(46)17-18-47-36/h9-10,14-15,17-18,20,22,24-28,30,32-33,35,37,47,49,51H,7-8,11-13,16,19,21H2,1-6H3,(H,48,52)(H,53,54)/b10-9+,23-20+/t24-,25+,26-,27+,28-,30+,32+,33-,35+,37-,43-,44+,45+/m0/s1 |
| InChIKey | YKLXDAWPGVZXKC-NMNDIUEASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actinomadura (ncbitaxon:1988) | - | PubMed (10726925) | Strain: MK73 NF4 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| decatromicin A (CHEBI:65728) has role antibacterial agent (CHEBI:33282) |
| decatromicin A (CHEBI:65728) has role antimicrobial agent (CHEBI:33281) |
| decatromicin A (CHEBI:65728) has role metabolite (CHEBI:25212) |
| decatromicin A (CHEBI:65728) is a amide (CHEBI:32988) |
| decatromicin A (CHEBI:65728) is a carbohydrate-containing antibiotic (CHEBI:23007) |
| decatromicin A (CHEBI:65728) is a cyclic ketone (CHEBI:3992) |
| decatromicin A (CHEBI:65728) is a macrocycle (CHEBI:51026) |
| decatromicin A (CHEBI:65728) is a monocarboxylic acid (CHEBI:25384) |
| decatromicin A (CHEBI:65728) is a organochlorine compound (CHEBI:36683) |
| decatromicin A (CHEBI:65728) is a oxaspiro compound (CHEBI:37948) |
| decatromicin A (CHEBI:65728) is a pyrroles (CHEBI:26455) |
| decatromicin A (CHEBI:65728) is a trideoxyhexose derivative (CHEBI:63349) |
| decatromicin A (CHEBI:65728) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3S,4S,4aS,6aR,8E,11E,12aS,15S,16aS,20aR,20bR)-4-[(4-{[(3-chloro-1H-pyrrol-2-yl)carbonyl]amino}-2,4,6-trideoxy-β-D-arabino-hexopyranosyl)oxy]-15,20a-diethyl-21-hydroxy-3,11,12a-trimethyl-18,20-dioxo-1,2,3,4,4a,6a,7,10,12a,15,16,20,20a,20b-tetradecahydro-16a,19-(metheno)benzo[b]naphtho[2,1-j]oxacyclotetradecine-14(18H)-carboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8469607 | Reaxys |
| Citations |
|---|