EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H44O13 |
| Net Charge | 0 |
| Average Mass | 660.713 |
| Monoisotopic Mass | 660.27819 |
| SMILES | [H][C@@]12C[C@@H](O)[C@]3(C)[C@]([H])(C(=O)[C@H](O)[C@@]4(C)[C@H](c5ccoc5)C[C@@]5([H])O[C@]435)[C@]13CO[C@@H](OC(=O)C(C)C)[C@@]2(C)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]3O |
| InChI | InChI=1S/C34H44O13/c1-14(2)28(41)46-29-30(5)19-11-20(37)32(7)24(33(19,13-43-29)26(40)23(44-15(3)35)27(30)45-16(4)36)22(38)25(39)31(6)18(17-8-9-42-12-17)10-21-34(31,32)47-21/h8-9,12,14,18-21,23-27,29,37,39-40H,10-11,13H2,1-7H3/t18-,19-,20+,21+,23+,24-,25-,26-,27+,29-,30+,31+,32+,33-,34+/m0/s1 |
| InChIKey | NVFHKAJEEUUJEX-PJZTXCKQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Melia azedarach (ncbitaxon:155640) | ripe fruit (PO:0007038) | PubMed (16205005) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-O-deacetyltrichilin H (CHEBI:65726) has role plant metabolite (CHEBI:76924) |
| 12-O-deacetyltrichilin H (CHEBI:65726) is a acetate ester (CHEBI:47622) |
| 12-O-deacetyltrichilin H (CHEBI:65726) is a epoxide (CHEBI:32955) |
| 12-O-deacetyltrichilin H (CHEBI:65726) is a furans (CHEBI:24129) |
| 12-O-deacetyltrichilin H (CHEBI:65726) is a limonoid (CHEBI:39434) |
| 12-O-deacetyltrichilin H (CHEBI:65726) is a organic heterohexacyclic compound (CHEBI:51914) |
| 12-O-deacetyltrichilin H (CHEBI:65726) is a secondary α-hydroxy ketone (CHEBI:2468) |
| 12-O-deacetyltrichilin H (CHEBI:65726) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| (1R,2R,3S,4R,4aR,6R,6aS,6bS,7aR,9R,9aR,10R,11aR,11bS,14S)-2,3-bis(acetyloxy)-9-(furan-3-yl)-1,6,10-trihydroxy-4,6a,9a-trimethyl-11-oxotetradecahydro-1H-4,11b-(methanooxymethano)naphtho[1',2':6,7]indeno[1,7a-b]oxiren-14-yl 2-methylpropanoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10233641 | Reaxys |
| Citations |
|---|