EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H48O11 |
| Net Charge | 0 |
| Average Mass | 656.769 |
| Monoisotopic Mass | 656.31966 |
| SMILES | [H][C@@]12[C@]3(C)[C@@H](OC(C)=O)C[C@@H](OC(C)=O)[C@@]1(C)CO[C@@]2([H])[C@@H](OC(=O)/C(C)=C/C)[C@@](C)(C1=C(C)[C@]([H])(c2ccoc2)C[C@@H]1O)[C@@H]3CC(=O)OC |
| InChI | InChI=1S/C36H48O11/c1-10-18(2)33(41)47-32-30-31-34(6,17-44-30)26(45-20(4)37)15-27(46-21(5)38)35(31,7)25(14-28(40)42-9)36(32,8)29-19(3)23(13-24(29)39)22-11-12-43-16-22/h10-12,16,23-27,30-32,39H,13-15,17H2,1-9H3/b18-10+/t23-,24+,25-,26-,27+,30-,31+,32-,34-,35+,36-/m1/s1 |
| InChIKey | BMWZKYUHNUEOJU-PNHGQMSBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Melia azedarach (ncbitaxon:155640) | ripe fruit (PO:0007038) | PubMed (16205005) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 15-O-deacetylnimbolidin B (CHEBI:65725) has functional parent tiglic acid (CHEBI:9592) |
| 15-O-deacetylnimbolidin B (CHEBI:65725) has role antineoplastic agent (CHEBI:35610) |
| 15-O-deacetylnimbolidin B (CHEBI:65725) has role metabolite (CHEBI:25212) |
| 15-O-deacetylnimbolidin B (CHEBI:65725) is a acetate ester (CHEBI:47622) |
| 15-O-deacetylnimbolidin B (CHEBI:65725) is a cyclic ether (CHEBI:37407) |
| 15-O-deacetylnimbolidin B (CHEBI:65725) is a enoate ester (CHEBI:51702) |
| 15-O-deacetylnimbolidin B (CHEBI:65725) is a furans (CHEBI:24129) |
| 15-O-deacetylnimbolidin B (CHEBI:65725) is a methyl ester (CHEBI:25248) |
| 15-O-deacetylnimbolidin B (CHEBI:65725) is a secondary alcohol (CHEBI:35681) |
| 15-O-deacetylnimbolidin B (CHEBI:65725) is a tricyclic triterpenoid (CHEBI:52340) |
| IUPAC Name |
|---|
| (2aR,3R,5S,5aR,6R,7R,8S,8aR,8bR)-3,5-bis(acetyloxy)-7-[(3R,5S)-3-(furan-3-yl)-5-hydroxy-2-methylcyclopent-1-en-1-yl]-6-(2-methoxy-2-oxoethyl)-2a,5a,7-trimethyldecahydro-2H-naphtho[1,8-bc]furan-8-yl (2E)-2-methylbut-2-enoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10233019 | Reaxys |
| Citations |
|---|