EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H52O6 |
| Net Charge | 0 |
| Average Mass | 508.740 |
| Monoisotopic Mass | 508.37639 |
| SMILES | [H][C@]12C[C@@H](O)[C@]3([H])[C@@]([H])([C@@](C)(O)C(O)C[C@H](O)C(=C)C)CC[C@@]3(C)[C@]1(C)C[C@H](O)[C@@]1([H])C(C)(C)[C@@H](O)CC[C@]21C |
| InChI | InChI=1S/C30H52O6/c1-16(2)18(31)14-23(35)30(8,36)17-9-12-28(6)24(17)19(32)13-21-27(5)11-10-22(34)26(3,4)25(27)20(33)15-29(21,28)7/h17-25,31-36H,1,9-15H2,2-8H3/t17-,18-,19+,20-,21+,22-,23?,24-,25-,27+,28+,29+,30+/m0/s1 |
| InChIKey | YLRZIFDQYSWFML-ZOFAZQJHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Panax ginseng (ncbitaxon:4054) | leaf (BTO:0000713) | PubMed (18409045) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 20(R),22(ξ),24(S)-dammar-25(26)-ene-3β,6α,12β,20,22,24-hexanol (CHEBI:65722) has parent hydride dammarane (CHEBI:36488) |
| 20(R),22(ξ),24(S)-dammar-25(26)-ene-3β,6α,12β,20,22,24-hexanol (CHEBI:65722) has role antineoplastic agent (CHEBI:35610) |
| 20(R),22(ξ),24(S)-dammar-25(26)-ene-3β,6α,12β,20,22,24-hexanol (CHEBI:65722) has role metabolite (CHEBI:25212) |
| 20(R),22(ξ),24(S)-dammar-25(26)-ene-3β,6α,12β,20,22,24-hexanol (CHEBI:65722) is a hexol (CHEBI:37206) |
| 20(R),22(ξ),24(S)-dammar-25(26)-ene-3β,6α,12β,20,22,24-hexanol (CHEBI:65722) is a tertiary alcohol (CHEBI:26878) |
| 20(R),22(ξ),24(S)-dammar-25(26)-ene-3β,6α,12β,20,22,24-hexanol (CHEBI:65722) is a tetracyclic triterpenoid (CHEBI:26893) |
| IUPAC Name |
|---|
| (3β,6α,12β,24S)-dammar-25-ene-3,6,12,20,22,24-hexol |
| Citations |
|---|