EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H34O6 |
| Net Charge | 0 |
| Average Mass | 394.508 |
| Monoisotopic Mass | 394.23554 |
| SMILES | [H][C@@]12[C@@H](C(=O)O)C[C@@H](C)C[C@@]1([H])C(=O)C(O)=C([C@H](C)CCCC)[C@@]2(C)C(=O)CCO |
| InChI | InChI=1S/C22H34O6/c1-5-6-7-13(3)17-20(26)19(25)14-10-12(2)11-15(21(27)28)18(14)22(17,4)16(24)8-9-23/h12-15,18,23,26H,5-11H2,1-4H3,(H,27,28)/t12-,13+,14+,15-,18-,22+/m0/s1 |
| InChIKey | DHAUNSINPICAFU-DSGRLQPCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cytospora (ncbitaxon:117544) | - | PubMed (12713414) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. HIV-1 integrase inhibitor An inhibitor of HIV-1 integrase, an enzyme required for the integration of the genetic material of the retrovirus into the DNA of the infected cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cytosporic acid (CHEBI:65719) has role HIV-1 integrase inhibitor (CHEBI:67268) |
| cytosporic acid (CHEBI:65719) has role metabolite (CHEBI:25212) |
| cytosporic acid (CHEBI:65719) is a cyclic ketone (CHEBI:3992) |
| cytosporic acid (CHEBI:65719) is a dioxo monocarboxylic acid (CHEBI:35951) |
| cytosporic acid (CHEBI:65719) is a enol (CHEBI:33823) |
| cytosporic acid (CHEBI:65719) is a hexahydronaphthalenes (CHEBI:142348) |
| cytosporic acid (CHEBI:65719) is a primary alcohol (CHEBI:15734) |
| cytosporic acid (CHEBI:65719) is a β-hydroxy ketone (CHEBI:55380) |
| IUPAC Name |
|---|
| (1S,3S,4aR,8S,8aS)-7-[(2R)-hexan-2-yl]-6-hydroxy-8-(3-hydroxypropanoyl)-3,8-dimethyl-5-oxo-1,2,3,4,4a,8a-hexahydronaphthalene-1-carboxylic acid |
| Synonym | Source |
|---|---|
| (1S,3S,4aR,8S,8aS) 1,2,3,4,4a,5,8,8a-octahydro-6-hydroxy-8-(3-hydroxy-1-oxopropyl)-3,8-dimethyl-7-[(1R)-1-methylpentyl]-5-oxo-1-naphthalenecarboxylic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9533928 | Reaxys |
| Citations |
|---|