EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H34O6 |
| Net Charge | 0 |
| Average Mass | 394.508 |
| Monoisotopic Mass | 394.23554 |
| SMILES | [H][C@@]12[C@@H](C(=O)O)C[C@@H](C)C[C@@]1([H])C(=O)C(O)=C([C@H](C)CCCC)[C@@]2(C)C(=O)CCO |
| InChI | InChI=1S/C22H34O6/c1-5-6-7-13(3)17-20(26)19(25)14-10-12(2)11-15(21(27)28)18(14)22(17,4)16(24)8-9-23/h12-15,18,23,26H,5-11H2,1-4H3,(H,27,28)/t12-,13+,14+,15-,18-,22+/m0/s1 |
| InChIKey | DHAUNSINPICAFU-DSGRLQPCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cytospora (ncbitaxon:117544) | - | PubMed (12713414) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | HIV-1 integrase inhibitor An inhibitor of HIV-1 integrase, an enzyme required for the integration of the genetic material of the retrovirus into the DNA of the infected cells. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cytosporic acid (CHEBI:65719) has role HIV-1 integrase inhibitor (CHEBI:67268) |
| cytosporic acid (CHEBI:65719) has role metabolite (CHEBI:25212) |
| cytosporic acid (CHEBI:65719) is a cyclic ketone (CHEBI:3992) |
| cytosporic acid (CHEBI:65719) is a dioxo monocarboxylic acid (CHEBI:35951) |
| cytosporic acid (CHEBI:65719) is a enol (CHEBI:33823) |
| cytosporic acid (CHEBI:65719) is a hexahydronaphthalenes (CHEBI:142348) |
| cytosporic acid (CHEBI:65719) is a primary alcohol (CHEBI:15734) |
| cytosporic acid (CHEBI:65719) is a β-hydroxy ketone (CHEBI:55380) |
| IUPAC Name |
|---|
| (1S,3S,4aR,8S,8aS)-7-[(2R)-hexan-2-yl]-6-hydroxy-8-(3-hydroxypropanoyl)-3,8-dimethyl-5-oxo-1,2,3,4,4a,8a-hexahydronaphthalene-1-carboxylic acid |
| Synonym | Source |
|---|---|
| (1S,3S,4aR,8S,8aS) 1,2,3,4,4a,5,8,8a-octahydro-6-hydroxy-8-(3-hydroxy-1-oxopropyl)-3,8-dimethyl-7-[(1R)-1-methylpentyl]-5-oxo-1-naphthalenecarboxylic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9533928 | Reaxys |
| Citations |
|---|