EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26N2O4S2 |
| Net Charge | 0 |
| Average Mass | 422.572 |
| Monoisotopic Mass | 422.13340 |
| SMILES | COC(=O)/C=C(/OC)[C@H](C)[C@H](/C=C/c1csc(-c2csc(C(C)C)n2)n1)OC |
| InChI | InChI=1S/C20H26N2O4S2/c1-12(2)19-22-15(11-28-19)20-21-14(10-27-20)7-8-16(24-4)13(3)17(25-5)9-18(23)26-6/h7-13,16H,1-6H3/b8-7+,17-9+/t13-,16+/m1/s1 |
| InChIKey | LRTJMINIVSPVMX-ZVJWTWILSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cystobacter fuscus (ncbitaxon:43) | - | PubMed (9589062) |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cystothiazole A (CHEBI:65716) has role antifungal agent (CHEBI:35718) |
| cystothiazole A (CHEBI:65716) has role antineoplastic agent (CHEBI:35610) |
| cystothiazole A (CHEBI:65716) has role bacterial metabolite (CHEBI:76969) |
| cystothiazole A (CHEBI:65716) is a 1,3-thiazoles (CHEBI:38418) |
| cystothiazole A (CHEBI:65716) is a biaryl (CHEBI:64459) |
| cystothiazole A (CHEBI:65716) is a enoate ester (CHEBI:51702) |
| cystothiazole A (CHEBI:65716) is a enol ether (CHEBI:47985) |
| cystothiazole A (CHEBI:65716) is a methyl ester (CHEBI:25248) |
| cystothiazole A (CHEBI:65716) is a organonitrogen heterocyclic antibiotic (CHEBI:25558) |
| IUPAC Name |
|---|
| methyl (2E,4R,5S,6E)-3,5-dimethoxy-4-methyl-7-[2'-(propan-2-yl)-2,4'-bi-1,3-thiazol-4-yl]hepta-2,6-dienoate |
| Synonyms | Source |
|---|---|
| melithiazole E | ChEBI |
| (+)-cystothiazole A | ChEBI |
| Cystothiazole A | KEGG COMPOUND |
| Citations |
|---|