EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O7 |
| Net Charge | 0 |
| Average Mass | 318.281 |
| Monoisotopic Mass | 318.07395 |
| SMILES | COC(=O)c1ccc(O)c(Oc2cc(C(=O)OC)ccc2O)c1 |
| InChI | InChI=1S/C16H14O7/c1-21-15(19)9-3-5-11(17)13(7-9)23-14-8-10(16(20)22-2)4-6-12(14)18/h3-8,17-18H,1-2H3 |
| InChIKey | OEYSNLOOZVNLRA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Imperata cylindrica (ncbitaxon:80369) | rhizome (BTO:0001181) | PubMed (7798964) |
| Roles Classification |
|---|
| Biological Roles: | EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor A lipoxygenase inhibitor that interferes with the action of arachidonate 5-lipoxygenase (EC 1.13.11.34). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cylindol A (CHEBI:65709) has role EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor (CHEBI:64964) |
| cylindol A (CHEBI:65709) has role plant metabolite (CHEBI:76924) |
| cylindol A (CHEBI:65709) is a aromatic ether (CHEBI:35618) |
| cylindol A (CHEBI:65709) is a benzoate ester (CHEBI:36054) |
| cylindol A (CHEBI:65709) is a methyl ester (CHEBI:25248) |
| cylindol A (CHEBI:65709) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| dimethyl 3,3'-oxybis(4-hydroxybenzoate) |
| Synonym | Source |
|---|---|
| methyl 4-hydroxy-3-(2-hydroxy-5-methoxycarbonylphenoxy)benzoate | ChEBI |
| Citations |
|---|