EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H48N8O9 |
| Net Charge | 0 |
| Average Mass | 712.805 |
| Monoisotopic Mass | 712.35443 |
| SMILES | [H][C@@]12CCCN1C(=O)[C@H](CC(C)C)NC(=O)CNC(=O)[C@]1([H])CCCN1C(=O)[C@H](CC(N)=O)NC(=O)[C@H](C)NC(=O)[C@H](Cc1ccc(O)cc1)NC2=O |
| InChI | InChI=1S/C34H48N8O9/c1-18(2)14-23-33(50)42-13-5-7-26(42)32(49)39-22(15-20-8-10-21(43)11-9-20)30(47)37-19(3)29(46)40-24(16-27(35)44)34(51)41-12-4-6-25(41)31(48)36-17-28(45)38-23/h8-11,18-19,22-26,43H,4-7,12-17H2,1-3H3,(H2,35,44)(H,36,48)(H,37,47)(H,38,45)(H,39,49)(H,40,46)/t19-,22-,23-,24-,25-,26-/m0/s1 |
| InChIKey | SRGSUICLJQYQAF-KTHKBMNISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Annona montana (ncbitaxon:49857) | seed (BTO:0001226) | PubMed (18687006) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyclomontanin D (CHEBI:65708) has role anti-inflammatory agent (CHEBI:67079) |
| cyclomontanin D (CHEBI:65708) has role metabolite (CHEBI:25212) |
| cyclomontanin D (CHEBI:65708) is a homodetic cyclic peptide (CHEBI:24613) |
| IUPAC Name |
|---|
| cyclo(L-alanyl-L-asparaginyl-L-prolylglycyl-L-leucyl-L-prolyl-L-tyrosyl) |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18863995 | Reaxys |
| Citations |
|---|