EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C51H67N13O12 |
| Net Charge | 0 |
| Average Mass | 1054.176 |
| Monoisotopic Mass | 1053.50321 |
| SMILES | [H][C@@]12CCCN1C(=O)[C@]1([H])CCCN1C(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](C(C)C)NC(=O)[C@H](Cc1cncn1)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@]([H])([C@@H](C)O)NC2=O |
| InChI | InChI=1S/C51H67N13O12/c1-27(2)41-48(73)59-35(24-40(53)67)45(70)60-36(21-30-14-8-5-9-15-30)50(75)64-19-11-17-38(64)51(76)63-18-10-16-37(63)47(72)62-42(28(3)65)49(74)58-32(20-29-12-6-4-7-13-29)43(68)57-34(23-39(52)66)44(69)56-33(46(71)61-41)22-31-25-54-26-55-31/h4-9,12-15,25-28,32-38,41-42,65H,10-11,16-24H2,1-3H3,(H2,52,66)(H2,53,67)(H,54,55)(H,56,69)(H,57,68)(H,58,74)(H,59,73)(H,60,70)(H,61,71)(H,62,72)/t28-,32+,33+,34+,35+,36+,37+,38+,41+,42+/m1/s1 |
| InChIKey | POVFXEIWKRHEKP-GCGRWEQZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Annona montana (ncbitaxon:49857) | seed (BTO:0001226) | PubMed (18687006) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyclomontanin C (CHEBI:65707) has role anti-inflammatory agent (CHEBI:67079) |
| cyclomontanin C (CHEBI:65707) has role metabolite (CHEBI:25212) |
| cyclomontanin C (CHEBI:65707) is a homodetic cyclic peptide (CHEBI:24613) |
| IUPAC Name |
|---|
| cyclo(L-asparaginyl-L-phenylalanyl-L-prolyl-L-prolyl-L-threonyl-L-phenylalanyl-L-asparaginyl-L-histidyl-L-valyl) |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18864003 | Reaxys |
| Citations |
|---|