EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H49N9O9 |
| Net Charge | 0 |
| Average Mass | 739.831 |
| Monoisotopic Mass | 739.36532 |
| SMILES | [H][C@@]12CCCN1C(=O)[C@]([H])([C@@H](C)O)NC(=O)[C@H](Cc1cnc3ccccc13)NC(=O)[C@H](C)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)CNC2=O |
| InChI | InChI=1S/C35H49N9O9/c1-17(2)12-23-32(50)42-25(14-27(36)46)31(49)39-18(3)30(48)41-24(13-20-15-37-22-9-6-5-8-21(20)22)33(51)43-29(19(4)45)35(53)44-11-7-10-26(44)34(52)38-16-28(47)40-23/h5-6,8-9,15,17-19,23-26,29,37,45H,7,10-14,16H2,1-4H3,(H2,36,46)(H,38,52)(H,39,49)(H,40,47)(H,41,48)(H,42,50)(H,43,51)/t18-,19+,23-,24-,25-,26-,29-/m0/s1 |
| InChIKey | BJDACJTXTXRXOB-YOGBPHHOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Annona montana (ncbitaxon:49857) | seed (BTO:0001226) | PubMed (18687006) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyclomontanin A (CHEBI:65706) has role anti-inflammatory agent (CHEBI:67079) |
| cyclomontanin A (CHEBI:65706) has role metabolite (CHEBI:25212) |
| cyclomontanin A (CHEBI:65706) is a homodetic cyclic peptide (CHEBI:24613) |
| IUPAC Name |
|---|
| cyclo(L-alanyl-L-tryptophyl-L-threonyl-L-prolylglycyl-L-leucyl-L-asparaginyl) |
| Synonym | Source |
|---|---|
| 2-[(6S,9R,12S,15S,18S,23aS)-18-[(1R)-1-hydroxyethyl]-15-(1H-indol-3-ylmethyl)-12-methyl-6-(2-methylpropyl)-1,4,7,10,13,16,19-heptaoxodocosahydro-1H-pyrrolo[1,2-a][1,4,7,10,13,16,19]heptaazacyclohenicosin-9-yl]acetamide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18863997 | Reaxys |
| Citations |
|---|