EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20O8 |
| Net Charge | 0 |
| Average Mass | 388.372 |
| Monoisotopic Mass | 388.11582 |
| SMILES | C/C=C/c1cc2c(c(=O)o1)-c1c(O)c(O)c(OC)c(C=O)c1C(OC(C)C)O2 |
| InChI | InChI=1S/C20H20O8/c1-5-6-10-7-12-14(19(24)27-10)15-13(20(28-12)26-9(2)3)11(8-21)18(25-4)17(23)16(15)22/h5-9,20,22-23H,1-4H3/b6-5+ |
| InChIKey | BNFPYGWOFGPTQR-AATRIKPKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cyathus stercoreus (ncbitaxon:181520) | - | PubMed (17511503) |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyathusal C (CHEBI:65704) has role fungal metabolite (CHEBI:76946) |
| cyathusal C (CHEBI:65704) has role radical scavenger (CHEBI:48578) |
| cyathusal C (CHEBI:65704) is a arenecarbaldehyde (CHEBI:33855) |
| cyathusal C (CHEBI:65704) is a aromatic ether (CHEBI:35618) |
| cyathusal C (CHEBI:65704) is a cyclic ether (CHEBI:37407) |
| cyathusal C (CHEBI:65704) is a organic heterotricyclic compound (CHEBI:26979) |
| cyathusal C (CHEBI:65704) is a polyketide (CHEBI:26188) |
| cyathusal C (CHEBI:65704) is a polyphenol (CHEBI:26195) |
| cyathusal C (CHEBI:65704) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| 9,10-dihydroxy-8-methoxy-1-oxo-6-(propan-2-yloxy)-3-[(1E)-prop-1-en-1-yl]-1H,6H-pyrano[4,3-c]isochromene-7-carbaldehyde |
| Manual Xrefs | Databases |
|---|---|
| 20568730 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11195427 | Reaxys |
| Citations |
|---|