EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O |
| Net Charge | 0 |
| Average Mass | 426.729 |
| Monoisotopic Mass | 426.38617 |
| SMILES | [H][C@]12CC[C@@]3([H])[C@@](C)(CC[C@@]4(C)CC[C@@H](C(=C)C)[C@@]43[H])[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O)CC[C@]21C |
| InChI | InChI=1S/C30H50O/c1-19(2)20-11-14-27(5)17-18-29(7)21(25(20)27)9-10-23-28(6)15-13-24(31)26(3,4)22(28)12-16-30(23,29)8/h20-25,31H,1,9-18H2,2-8H3/t20-,21+,22-,23+,24-,25+,27+,28-,29+,30+/m0/s1 |
| InChIKey | MQYXUWHLBZFQQO-QGTGJCAVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Breynia fruticosa (ncbitaxon:296042) | root (BTO:0001188) | PubMed (21428418) | 90% Methanolic extract of air-dried, crushed roots. |
| Croton gratissimus (ncbitaxon:316784) | |||
| leaf (BTO:0000713) | PubMed (22032651) | Combined hexane,methylene chloride,ethyl acetate and methanol extract of Ground leaves | |
| stem (BTO:0001300) | PubMed (22032651) | Previous component: stem bark; Combined hexane,methylene chloride,ethyl acetate and methanol extract of Ground leaves | |
| Juglans sinensis (ncbitaxon:442437-1) | |||
| leaf (BTO:0000713) | PubMed (21309591) | 80% Methanolic extract of dried leaves and twigs | |
| twig (BTO:0001411) | PubMed (21309591) | 80% Methanolic extract of dried leaves and twigs |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-inflammatory drug A substance that reduces or suppresses inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lupeol (CHEBI:6570) has parent hydride lupane (CHEBI:36485) |
| lupeol (CHEBI:6570) has role anti-inflammatory drug (CHEBI:35472) |
| lupeol (CHEBI:6570) has role plant metabolite (CHEBI:76924) |
| lupeol (CHEBI:6570) is a pentacyclic triterpenoid (CHEBI:25872) |
| lupeol (CHEBI:6570) is a secondary alcohol (CHEBI:35681) |
| Incoming Relation(s) |
| 3-(Z)-caffeoyllupeol (CHEBI:65549) has functional parent lupeol (CHEBI:6570) |
| IUPAC Name |
|---|
| (3β)-lup-20(29)-en-3-ol |
| Synonyms | Source |
|---|---|
| beta-viscol | ChemIDplus |
| fagarasterol | ChemIDplus |
| monogynol B | ChemIDplus |
| UniProt Name | Source |
|---|---|
| lupeol | UniProt |
| Citations |
|---|