EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H28O10 |
| Net Charge | 0 |
| Average Mass | 584.577 |
| Monoisotopic Mass | 584.16825 |
| SMILES | CC(=O)Oc1c(OC(C)=O)c(-c2ccc(O)cc2)c(OC(=O)CCc2ccccc2)c(OC(C)=O)c1-c1ccc(O)cc1 |
| InChI | InChI=1S/C33H28O10/c1-19(34)40-30-28(23-10-14-25(37)15-11-23)32(42-21(3)36)33(43-27(39)18-9-22-7-5-4-6-8-22)29(31(30)41-20(2)35)24-12-16-26(38)17-13-24/h4-8,10-17,37-38H,9,18H2,1-3H3 |
| InChIKey | FVIXJWLGXKDNER-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paxillus curtisii (ncbitaxon:217300) | fruit body (BTO:0000487) | PubMed (10805570) |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| curtisian B (CHEBI:65697) has parent hydride 1,4-diphenylbenzene (CHEBI:52242) |
| curtisian B (CHEBI:65697) has role metabolite (CHEBI:25212) |
| curtisian B (CHEBI:65697) has role radical scavenger (CHEBI:48578) |
| curtisian B (CHEBI:65697) is a para-terphenyl (CHEBI:75874) |
| curtisian B (CHEBI:65697) is a 3-phenylpropionate ester (CHEBI:50791) |
| curtisian B (CHEBI:65697) is a acetate ester (CHEBI:47622) |
| curtisian B (CHEBI:65697) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 3',5',6'-tris(acetyloxy)-4,4''-dihydroxy-1,1':4',1''-terphenyl-2'-yl 3-phenylpropanoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9673518 | Reaxys |
| Citations |
|---|