EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H26O12 |
| Net Charge | 0 |
| Average Mass | 554.504 |
| Monoisotopic Mass | 554.14243 |
| SMILES | O=c1c(O)c(-c2ccc(O)cc2)oc2cc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(Cc3ccc(O)cc3)c(O)c12 |
| InChI | InChI=1S/C28H26O12/c29-11-19-22(33)24(35)26(37)28(40-19)39-17-10-18-20(21(32)16(17)9-12-1-5-14(30)6-2-12)23(34)25(36)27(38-18)13-3-7-15(31)8-4-13/h1-8,10,19,22,24,26,28-33,35-37H,9,11H2/t19-,22-,24+,26-,28-/m1/s1 |
| InChIKey | DFSHKSZMUPLVMU-ISIWZGILSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cudrania tricuspidata (ncbitaxon:210328) | root (BTO:0001188) | PubMed (19280148) | Previous component: root bark; |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cudranian 1 (CHEBI:65687) has functional parent kaempferol (CHEBI:28499) |
| cudranian 1 (CHEBI:65687) has role metabolite (CHEBI:25212) |
| cudranian 1 (CHEBI:65687) has role radical scavenger (CHEBI:48578) |
| cudranian 1 (CHEBI:65687) is a flavonol 7-O-β-D-glucoside (CHEBI:52144) |
| cudranian 1 (CHEBI:65687) is a monosaccharide derivative (CHEBI:63367) |
| IUPAC Name |
|---|
| 3,5-dihydroxy-6-(4-hydroxybenzyl)-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-7-yl β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| 6-p-hydroxybenzyl kaempferol-7-O-β-D-glucopyranoside | ChEBI |
| Citations |
|---|