EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24O6 |
| Net Charge | 0 |
| Average Mass | 396.439 |
| Monoisotopic Mass | 396.15729 |
| SMILES | C=CC(C)(C)c1c(O)cc(O)c2c(=O)c3c(CC=C(C)C)c(O)c(O)cc3oc12 |
| InChI | InChI=1S/C23H24O6/c1-6-23(4,5)19-14(25)9-13(24)18-21(28)17-12(8-7-11(2)3)20(27)15(26)10-16(17)29-22(18)19/h6-7,9-10,24-27H,1,8H2,2-5H3 |
| InChIKey | FUEJTEBWTNXAPG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cudrania tricuspidata (ncbitaxon:210328) | root (BTO:0001188) | PubMed (15787460) | Previous component: root bark; |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor A compound or agent that combines with cyclooxygenases (EC 1.14.99.1) and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of icosanoids, prostaglandins, and thromboxanes. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cudratricusxanthone A (CHEBI:65686) has role anti-inflammatory agent (CHEBI:67079) |
| cudratricusxanthone A (CHEBI:65686) has role antineoplastic agent (CHEBI:35610) |
| cudratricusxanthone A (CHEBI:65686) has role EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor (CHEBI:35544) |
| cudratricusxanthone A (CHEBI:65686) has role metabolite (CHEBI:25212) |
| cudratricusxanthone A (CHEBI:65686) is a polyphenol (CHEBI:26195) |
| cudratricusxanthone A (CHEBI:65686) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| 2,3,6,8-tetrahydroxy-5-(2-methylbut-3-en-2-yl)-1-(3-methylbut-2-en-1-yl)-9H-xanthen-9-one |
| Synonym | Source |
|---|---|
| CTXA | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9817853 | Reaxys |
| Citations |
|---|