EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24O6 |
| Net Charge | 0 |
| Average Mass | 396.439 |
| Monoisotopic Mass | 396.15729 |
| SMILES | C=CC(C)(C)c1c(O)cc(O)c2c(=O)c3c(CC=C(C)C)c(O)c(O)cc3oc12 |
| InChI | InChI=1S/C23H24O6/c1-6-23(4,5)19-14(25)9-13(24)18-21(28)17-12(8-7-11(2)3)20(27)15(26)10-16(17)29-22(18)19/h6-7,9-10,24-27H,1,8H2,2-5H3 |
| InChIKey | FUEJTEBWTNXAPG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cudrania tricuspidata (ncbitaxon:210328) | root (BTO:0001188) | PubMed (15787460) | Previous component: root bark; |
| Roles Classification |
|---|
| Biological Roles: | EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor A compound or agent that combines with cyclooxygenases (EC 1.14.99.1) and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of icosanoids, prostaglandins, and thromboxanes. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cudratricusxanthone A (CHEBI:65686) has role anti-inflammatory agent (CHEBI:67079) |
| cudratricusxanthone A (CHEBI:65686) has role antineoplastic agent (CHEBI:35610) |
| cudratricusxanthone A (CHEBI:65686) has role EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor (CHEBI:35544) |
| cudratricusxanthone A (CHEBI:65686) has role metabolite (CHEBI:25212) |
| cudratricusxanthone A (CHEBI:65686) is a polyphenol (CHEBI:26195) |
| cudratricusxanthone A (CHEBI:65686) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| 2,3,6,8-tetrahydroxy-5-(2-methylbut-3-en-2-yl)-1-(3-methylbut-2-en-1-yl)-9H-xanthen-9-one |
| Synonym | Source |
|---|---|
| CTXA | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9817853 | Reaxys |
| Citations |
|---|