EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30O5 |
| Net Charge | 0 |
| Average Mass | 434.532 |
| Monoisotopic Mass | 434.20932 |
| SMILES | COc1ccc([C@@H]2CC(=O)c3cc(CC=C(C)C)c4c(c3O2)C=CC(C)(C)O4)cc1OC |
| InChI | InChI=1S/C27H30O5/c1-16(2)7-8-18-13-20-21(28)15-23(17-9-10-22(29-5)24(14-17)30-6)31-26(20)19-11-12-27(3,4)32-25(18)19/h7,9-14,23H,8,15H2,1-6H3/t23-/m0/s1 |
| InChIKey | KJBZFWLVOZNDBN-QHCPKHFHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lonchocarpus urucu (IPNI:503126-1) | root (BTO:0001188) | PubMed (10075742) | Cube resin, and extract of roots of Lonchocarpus utilis and Lonchocarpus urucu |
| Lonchocarpus utilis (IPNI:503127-1) | root (BTO:0001188) | PubMed (10075742) | Cube resin, and extract of roots of Lonchocarpus utilis and Lonchocarpus urucu |
| Roles Classification |
|---|
| Biological Roles: | EC 1.6.5.3 [NADH:ubiquinone reductase (H(+)-translocating)] inhibitor A respiratory-chain inhibitor that interferes with the action of the the enzyme NADH:ubiquinone reductase (H+-translocating), EC 1.6.5.3. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-6-(γ,γ-dimethylallyl)-3',4'-dimethoxy-6'',6''-dimethylpyran[2'',3'':7,8]flavanone (CHEBI:65683) has role EC 1.6.5.3 [NADH:ubiquinone reductase (H+-translocating)] inhibitor (CHEBI:38503) |
| (2S)-6-(γ,γ-dimethylallyl)-3',4'-dimethoxy-6'',6''-dimethylpyran[2'',3'':7,8]flavanone (CHEBI:65683) has role plant metabolite (CHEBI:76924) |
| (2S)-6-(γ,γ-dimethylallyl)-3',4'-dimethoxy-6'',6''-dimethylpyran[2'',3'':7,8]flavanone (CHEBI:65683) is a 3'-methoxyflavanones (CHEBI:140351) |
| (2S)-6-(γ,γ-dimethylallyl)-3',4'-dimethoxy-6'',6''-dimethylpyran[2'',3'':7,8]flavanone (CHEBI:65683) is a 4'-methoxyflavanones (CHEBI:140332) |
| (2S)-6-(γ,γ-dimethylallyl)-3',4'-dimethoxy-6'',6''-dimethylpyran[2'',3'':7,8]flavanone (CHEBI:65683) is a dimethoxyflavanone (CHEBI:38743) |
| (2S)-6-(γ,γ-dimethylallyl)-3',4'-dimethoxy-6'',6''-dimethylpyran[2'',3'':7,8]flavanone (CHEBI:65683) is a extended flavonoid (CHEBI:71037) |
| (2S)-6-(γ,γ-dimethylallyl)-3',4'-dimethoxy-6'',6''-dimethylpyran[2'',3'':7,8]flavanone (CHEBI:65683) is a pyranochromane (CHEBI:74632) |
| IUPAC Name |
|---|
| (2S)-2-(3,4-dimethoxyphenyl)-8,8-dimethyl-6-(3-methylbut-2-en-1-yl)-2,3-dihydro-4H,8H-pyrano[2,3-f]chromen-4-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8288982 | Reaxys |
| Citations |
|---|