EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H22O7 |
| Net Charge | 0 |
| Average Mass | 410.422 |
| Monoisotopic Mass | 410.13655 |
| SMILES | C=C(C)C1Cc2c(cc3oc4c(O)c(O)c(O)c(CC=C(C)C)c4c(=O)c3c2O)O1 |
| InChI | InChI=1S/C23H22O7/c1-9(2)5-6-11-16-20(26)17-15(30-23(16)22(28)21(27)19(11)25)8-14-12(18(17)24)7-13(29-14)10(3)4/h5,8,13,24-25,27-28H,3,6-7H2,1-2,4H3 |
| InChIKey | PIPKOMCOCGAXLZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cratoxylum Sumatranum (IPNI:433074-1) | |||
| leaf (BTO:0000713) | PubMed (11908969) | ||
| twig (BTO:0001411) | PubMed (11908969) | ||
| stem (BTO:0001300) | PubMed (11908969) | Previous component: stem bark; |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cratoxyarborenone D (CHEBI:65674) has role antineoplastic agent (CHEBI:35610) |
| cratoxyarborenone D (CHEBI:65674) has role metabolite (CHEBI:25212) |
| cratoxyarborenone D (CHEBI:65674) is a cyclic ether (CHEBI:37407) |
| cratoxyarborenone D (CHEBI:65674) is a cyclic ketone (CHEBI:3992) |
| cratoxyarborenone D (CHEBI:65674) is a organic heterotetracyclic compound (CHEBI:38163) |
| cratoxyarborenone D (CHEBI:65674) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 4,7,8,9-tetrahydroxy-6-(3-methylbut-2-en-1-yl)-2-(prop-1-en-2-yl)-2,3-dihydro-5H-furo[3,2-b]xanthen-5-one |
| Synonym | Source |
|---|---|
| 2,3-dihydro-1,5,6,7-tetrahydroxy-3-(1-methyethenyl)-8-prenylfuro[2,3-b]xanthone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9098517 | Reaxys |
| Citations |
|---|