EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H28O6 |
| Net Charge | 0 |
| Average Mass | 424.493 |
| Monoisotopic Mass | 424.18859 |
| SMILES | COc1cc(OC)c2oc3cc(O)c(CC=C(C)C)c(O)c3c(=O)c2c1CC=C(C)C |
| InChI | InChI=1S/C25H28O6/c1-13(2)7-9-15-17(26)11-19-22(23(15)27)24(28)21-16(10-8-14(3)4)18(29-5)12-20(30-6)25(21)31-19/h7-8,11-12,26-27H,9-10H2,1-6H3 |
| InChIKey | PGWGLEHDWSDHBH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cratoxylum Sumatranum (IPNI:433074-1) | |||
| stem (BTO:0001300) | PubMed (11908969) | Previous component: stem bark; | |
| leaf (BTO:0000713) | PubMed (11908969) | ||
| twig (BTO:0001411) | PubMed (11908969) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cratoxyarborenone C (CHEBI:65673) has role antineoplastic agent (CHEBI:35610) |
| cratoxyarborenone C (CHEBI:65673) has role metabolite (CHEBI:25212) |
| cratoxyarborenone C (CHEBI:65673) is a aromatic ether (CHEBI:35618) |
| cratoxyarborenone C (CHEBI:65673) is a polyphenol (CHEBI:26195) |
| cratoxyarborenone C (CHEBI:65673) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| 1,3-dihydroxy-5,7-dimethoxy-2,8-bis(3-methylbut-2-en-1-yl)-9H-xanthen-9-one |
| Synonym | Source |
|---|---|
| 1,3-dihydroxy-5,7-dimethoxy-2,8-diisoprenylxanthone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9093044 | Reaxys |
| Citations |
|---|