EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O3 |
| Net Charge | 0 |
| Average Mass | 316.441 |
| Monoisotopic Mass | 316.20384 |
| SMILES | [H][C@]12C/C(C)=C/[C@@H](O)C/C(C)=C/CC/C(C)=C/C[C@]1([H])C(=C)C(=O)O2 |
| InChI | InChI=1S/C20H28O3/c1-13-6-5-7-14(2)10-17(21)11-15(3)12-19-18(9-8-13)16(4)20(22)23-19/h7-8,11,17-19,21H,4-6,9-10,12H2,1-3H3/b13-8+,14-7+,15-11+/t17-,18+,19-/m0/s1 |
| InChIKey | BIDNFRVXQJTBCI-XXYAPWOQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lobophytum crassum (ncbitaxon:328265) | - | PubMed (18973388) |
| Roles Classification |
|---|
| Biological Role: | coral metabolite Any animal metabolite produced during a metabolic reaction in corals (marine invertebrates). |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| crassumolide A (CHEBI:65670) has role anti-inflammatory agent (CHEBI:67079) |
| crassumolide A (CHEBI:65670) has role antineoplastic agent (CHEBI:35610) |
| crassumolide A (CHEBI:65670) has role coral metabolite (CHEBI:76498) |
| crassumolide A (CHEBI:65670) is a cembrane diterpenoid (CHEBI:60687) |
| crassumolide A (CHEBI:65670) is a secondary alcohol (CHEBI:35681) |
| crassumolide A (CHEBI:65670) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3aR,5E,9E,12S,13E,15aS)-12-hydroxy-6,10,14-trimethyl-3-methylidene-3a,4,7,8,11,12,15,15a-octahydrocyclotetradeca[b]furan-2(3H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19388419 | Reaxys |
| Citations |
|---|