EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H34O9 |
| Net Charge | 0 |
| Average Mass | 490.549 |
| Monoisotopic Mass | 490.22028 |
| SMILES | [H][C@@]12O[C@@]1(C)[C@H](OC(C)=O)C/C=C(\C)[C@@H](OC(C)=O)C/C=C(\C)C[C@@H](OC(C)=O)[C@@]1([H])C(=C)C(=O)O[C@]21[H] |
| InChI | InChI=1S/C26H34O9/c1-13-8-10-19(31-16(4)27)14(2)9-11-21(33-18(6)29)26(7)24(35-26)23-22(15(3)25(30)34-23)20(12-13)32-17(5)28/h8-9,19-24H,3,10-12H2,1-2,4-7H3/b13-8+,14-9+/t19-,20+,21+,22+,23-,24-,26-/m0/s1 |
| InChIKey | OBGWQFODBKAPHA-DHJPSPATSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lobophytum michaelae (WORMS:288797) | - | PubMed (17473465) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| crassolide (CHEBI:65669) has role antineoplastic agent (CHEBI:35610) |
| crassolide (CHEBI:65669) has role metabolite (CHEBI:25212) |
| crassolide (CHEBI:65669) is a acetate ester (CHEBI:47622) |
| crassolide (CHEBI:65669) is a cembrane diterpenoid (CHEBI:60687) |
| crassolide (CHEBI:65669) is a epoxide (CHEBI:32955) |
| crassolide (CHEBI:65669) is a macrocycle (CHEBI:51026) |
| crassolide (CHEBI:65669) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (1aS,1bS,4aR,5R,7E,10S,11E,14R,14aS)-7,11,14a-trimethyl-4-methylidene-3-oxo-1a,1b,3,4,4a,5,6,9,10,13,14,14a-dodecahydrooxireno[13,14]cyclotetradeca[1,2-b]furan-5,10,14-triyl triacetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11101582 | Reaxys |
| CAS:66656-91-5 | ChemIDplus |
| Citations |
|---|