EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:65668 - crassifogenin C
| Formula | C17H16O8 |
| Net Charge | 0 |
| Average Mass | 348.307 |
| Monoisotopic Mass | 348.08452 |
| SMILES | [H]C1(O)OC1(CC(O)C(=O)c1ccc(O)c(O)c1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C17H16O8/c18-10-3-1-8(5-12(10)20)15(23)14(22)7-17(16(24)25-17)9-2-4-11(19)13(21)6-9/h1-6,14,16,18-22,24H,7H2 |
| InChIKey | ZQMYSZALBVRKFN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Curculigo crassifolia (ncbitaxon:4675) | rhizome (BTO:0001181) | PubMed (18958422) |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| crassifogenin C (CHEBI:65668) has role metabolite (CHEBI:25212) |
| crassifogenin C (CHEBI:65668) has role radical scavenger (CHEBI:48578) |
| crassifogenin C (CHEBI:65668) is a aromatic ketone (CHEBI:76224) |
| crassifogenin C (CHEBI:65668) is a catechols (CHEBI:33566) |
| crassifogenin C (CHEBI:65668) is a epoxide (CHEBI:32955) |
| crassifogenin C (CHEBI:65668) is a norlignan (CHEBI:53629) |
| crassifogenin C (CHEBI:65668) is a secondary alcohol (CHEBI:35681) |
| crassifogenin C (CHEBI:65668) is a secondary α-hydroxy ketone (CHEBI:2468) |
| crassifogenin C (CHEBI:65668) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| 3-deoxy-1,4-bis(3,4-dihydroxyphenyl)pentodialdo-5,4-oxirose |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22424263 | Reaxys |
| Citations |
|---|