EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C47H82N6O6 |
| Net Charge | 0 |
| Average Mass | 827.209 |
| Monoisotopic Mass | 826.62958 |
| SMILES | [H][C@]12CC[C@]3([H])[C@H](C(=O)OCCCCCCCCCCCCCCCCCC(=O)N(CCCN)CCCC(N)=O)[C@]4(CCC[C@@H](C)O4)N=C(N[C@]4(CCC=C[C@H](CC)O4)C1)N23 |
| InChI | InChI=1S/C47H82N6O6/c1-3-39-25-18-19-30-46(59-39)36-38-28-29-40-43(47(31-21-24-37(2)58-47)51-45(50-46)53(38)40)44(56)57-35-20-16-14-12-10-8-6-4-5-7-9-11-13-15-17-27-42(55)52(34-23-32-48)33-22-26-41(49)54/h18,25,37-40,43H,3-17,19-24,26-36,48H2,1-2H3,(H2,49,54)(H,50,51)/t37-,38+,39+,40-,43-,46+,47-/m1/s1 |
| InChIKey | FIZFMEDRNMJYPL-XMXBVVCASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Monanchora (ncbitaxon:283434) | - | PubMed (14640525) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | anti-HSV-1 agent An anti-HSV agent agent that destroys or inhibits the replication of herpes simplex virus-1. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. anti-HIV-1 agent An anti-HIV agent that destroys or inhibits the replication of HIV-1, the more infective and more virulent of the two types of HIV virus. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| crambescidin 826 (CHEBI:65667) has role anti-HIV-1 agent (CHEBI:64947) |
| crambescidin 826 (CHEBI:65667) has role anti-HSV-1 agent (CHEBI:64953) |
| crambescidin 826 (CHEBI:65667) has role marine metabolite (CHEBI:76507) |
| crambescidin 826 (CHEBI:65667) is a alkaloid (CHEBI:22315) |
| crambescidin 826 (CHEBI:65667) is a carboxylic ester (CHEBI:33308) |
| crambescidin 826 (CHEBI:65667) is a guanidines (CHEBI:24436) |
| crambescidin 826 (CHEBI:65667) is a monocarboxylic acid amide (CHEBI:29347) |
| crambescidin 826 (CHEBI:65667) is a organic heteropentacyclic compound (CHEBI:38164) |
| crambescidin 826 (CHEBI:65667) is a primary amino compound (CHEBI:50994) |
| crambescidin 826 (CHEBI:65667) is a spiro compound (CHEBI:33599) |
| IUPAC Name |
|---|
| 18-[(4-amino-4-oxobutyl)(3-aminopropyl)amino]-18-oxooctadecyl (2R,2a'S,3'R,4'S,6''S,7R,8a'R)-7-ethyl-6''-methyl-1',2',2a',3',3'',4,4'',5'',6'',7,8',8a'-dodecahydro-3H,6'H-dispiro[oxepine-2,7'-[5,6,8b] triazaacenaphthylene-4',2''-pyran]-3'-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 10223863 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9835644 | Reaxys |
| Citations |
|---|