EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C47H82N6O6 |
| Net Charge | 0 |
| Average Mass | 827.209 |
| Monoisotopic Mass | 826.62958 |
| SMILES | [H][C@]12CC[C@]3([H])[C@H](C(=O)OCCCCCCCCCCCCCCCCCC(=O)N(CCCN)CCCC(N)=O)[C@]4(CCC[C@@H](C)O4)N=C(N[C@]4(CCC=C[C@H](CC)O4)C1)N23 |
| InChI | InChI=1S/C47H82N6O6/c1-3-39-25-18-19-30-46(59-39)36-38-28-29-40-43(47(31-21-24-37(2)58-47)51-45(50-46)53(38)40)44(56)57-35-20-16-14-12-10-8-6-4-5-7-9-11-13-15-17-27-42(55)52(34-23-32-48)33-22-26-41(49)54/h18,25,37-40,43H,3-17,19-24,26-36,48H2,1-2H3,(H2,49,54)(H,50,51)/t37-,38+,39+,40-,43-,46+,47-/m1/s1 |
| InChIKey | FIZFMEDRNMJYPL-XMXBVVCASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Monanchora (ncbitaxon:283434) | - | PubMed (14640525) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. anti-HIV-1 agent An anti-HIV agent that destroys or inhibits the replication of HIV-1, the more infective and more virulent of the two types of HIV virus. anti-HSV-1 agent An anti-HSV agent agent that destroys or inhibits the replication of herpes simplex virus-1. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| crambescidin 826 (CHEBI:65667) has role anti-HIV-1 agent (CHEBI:64947) |
| crambescidin 826 (CHEBI:65667) has role anti-HSV-1 agent (CHEBI:64953) |
| crambescidin 826 (CHEBI:65667) has role marine metabolite (CHEBI:76507) |
| crambescidin 826 (CHEBI:65667) is a alkaloid (CHEBI:22315) |
| crambescidin 826 (CHEBI:65667) is a carboxylic ester (CHEBI:33308) |
| crambescidin 826 (CHEBI:65667) is a guanidines (CHEBI:24436) |
| crambescidin 826 (CHEBI:65667) is a monocarboxylic acid amide (CHEBI:29347) |
| crambescidin 826 (CHEBI:65667) is a organic heteropentacyclic compound (CHEBI:38164) |
| crambescidin 826 (CHEBI:65667) is a primary amino compound (CHEBI:50994) |
| crambescidin 826 (CHEBI:65667) is a spiro compound (CHEBI:33599) |
| IUPAC Name |
|---|
| 18-[(4-amino-4-oxobutyl)(3-aminopropyl)amino]-18-oxooctadecyl (2R,2a'S,3'R,4'S,6''S,7R,8a'R)-7-ethyl-6''-methyl-1',2',2a',3',3'',4,4'',5'',6'',7,8',8a'-dodecahydro-3H,6'H-dispiro[oxepine-2,7'-[5,6,8b] triazaacenaphthylene-4',2''-pyran]-3'-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 10223863 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9835644 | Reaxys |
| Citations |
|---|