EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H17NO3 |
| Net Charge | 0 |
| Average Mass | 283.327 |
| Monoisotopic Mass | 283.12084 |
| SMILES | O=C(/C=C/c1ccc(O)cc1)NCCc1ccc(O)cc1 |
| InChI | InChI=1S/C17H17NO3/c19-15-6-1-13(2-7-15)5-10-17(21)18-12-11-14-3-8-16(20)9-4-14/h1-10,19-20H,11-12H2,(H,18,21)/b10-5+ |
| InChIKey | RXGUTQNKCXHALN-BJMVGYQFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arcangelisia gusanlung (ncbitaxon:432629) | stem (BTO:0001300) | PubMed (21500777) | MeOH extract of air-dried and smashed stems |
| Asimina triloba (ncbitaxon:12953) | bark (BTO:0001301) | PubMed (1593281) | |
| Celtis chinensis (IPNI:851023-1) | twig (BTO:0001411) | PubMed (14560923) | |
| Nicotiana attenuata (ncbitaxon:49451) | - | MetaboLights (MTBLS335) | From MetaboLights |
| Solanum melongena (ncbitaxon:4111) | root (BTO:0001188) | DOI (10.1271/bbb1961.42.623) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-N-p-coumaroyl tyramine (CHEBI:65665) has role metabolite (CHEBI:25212) |
| trans-N-p-coumaroyl tyramine (CHEBI:65665) is a hydroxycinnamic acid (CHEBI:24689) |
| Synonyms | Source |
|---|---|
| (2E)-3-(4-Hydroxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]acrylamide | ChEBI |
| (E)-3-(4-hydroxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]prop-2-enamide | ChEBI |
| N-(4-hydroxy-beta-phenethyl)-4-hydroxycinnamide | ChEBI |
| UniProt Name | Source |
|---|---|
| N-[(E)-4-coumaroyl]tyramine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| HMDB0039521 | HMDB |
| Citations |
|---|