EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H26O10 |
| Net Charge | 0 |
| Average Mass | 462.451 |
| Monoisotopic Mass | 462.15260 |
| SMILES | O=C(/C=C/c1ccc(O)cc1)OC[C@H]1O[C@@H](OCCc2ccc(O)c(O)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H26O10/c24-15-5-1-13(2-6-15)4-8-19(27)32-12-18-20(28)21(29)22(30)23(33-18)31-10-9-14-3-7-16(25)17(26)11-14/h1-8,11,18,20-26,28-30H,9-10,12H2/b8-4+/t18-,20-,21+,22-,23-/m1/s1 |
| InChIKey | DNMNWOHCZHSQAI-FZYQUXMESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Globularia alypum (IPNI:813050-1) | aerial part (BTO:0001658) | PubMed (16124783) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6'-coumaroyl-1'-O-[2-(3,4-dihydroxyphenyl)ethyl]-β-D-glucopyranoside (CHEBI:65664) has functional parent trans-4-coumaric acid (CHEBI:32374) |
| 6'-coumaroyl-1'-O-[2-(3,4-dihydroxyphenyl)ethyl]-β-D-glucopyranoside (CHEBI:65664) has role antioxidant (CHEBI:22586) |
| 6'-coumaroyl-1'-O-[2-(3,4-dihydroxyphenyl)ethyl]-β-D-glucopyranoside (CHEBI:65664) has role metabolite (CHEBI:25212) |
| 6'-coumaroyl-1'-O-[2-(3,4-dihydroxyphenyl)ethyl]-β-D-glucopyranoside (CHEBI:65664) is a catechols (CHEBI:33566) |
| 6'-coumaroyl-1'-O-[2-(3,4-dihydroxyphenyl)ethyl]-β-D-glucopyranoside (CHEBI:65664) is a cinnamate ester (CHEBI:36087) |
| 6'-coumaroyl-1'-O-[2-(3,4-dihydroxyphenyl)ethyl]-β-D-glucopyranoside (CHEBI:65664) is a polyphenol (CHEBI:26195) |
| 6'-coumaroyl-1'-O-[2-(3,4-dihydroxyphenyl)ethyl]-β-D-glucopyranoside (CHEBI:65664) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)ethyl 6-O-[(2E)-3-(4-hydroxyphenyl)prop-2-enoyl]-β-D-glucopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15769700 | Reaxys |
| Citations |
|---|