EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H54O6 |
| Net Charge | 0 |
| Average Mass | 618.855 |
| Monoisotopic Mass | 618.39204 |
| SMILES | [H][C@]12CC[C@@]3([H])[C@@](C)(CC[C@@]4(C(=O)O)CC[C@@H](C(=C)C)[C@@]43[H])[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O)[C@H](OC(=O)/C=C/c3ccc(O)cc3)C[C@]21C |
| InChI | InChI=1S/C39H54O6/c1-23(2)26-16-19-39(34(43)44)21-20-37(6)27(32(26)39)13-14-30-36(5)22-28(33(42)35(3,4)29(36)17-18-38(30,37)7)45-31(41)15-10-24-8-11-25(40)12-9-24/h8-12,15,26-30,32-33,40,42H,1,13-14,16-22H2,2-7H3,(H,43,44)/b15-10+/t26-,27+,28+,29-,30+,32+,33-,36-,37+,38+,39-/m0/s1 |
| InChIKey | LCHMSLHVXVQJDG-GLDUGTPFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ziziphus cambodianus (IPNI:719271-1) | root (BTO:0001188) | PubMed (16595959) | Previous component: root bark; |
| Zizyphus jujuba (ncbitaxon:326968) | fruit (BTO:0000486) | Article (CHEM PHARM BULL,1978,26,6,1798) | Dried fruits |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-O-E-p-coumaroyl alphitolic acid (CHEBI:65662) has parent hydride lupane (CHEBI:36485) |
| 2-O-E-p-coumaroyl alphitolic acid (CHEBI:65662) has role antiplasmodial drug (CHEBI:64915) |
| 2-O-E-p-coumaroyl alphitolic acid (CHEBI:65662) has role plant metabolite (CHEBI:76924) |
| 2-O-E-p-coumaroyl alphitolic acid (CHEBI:65662) is a cinnamate ester (CHEBI:36087) |
| 2-O-E-p-coumaroyl alphitolic acid (CHEBI:65662) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| 2-O-E-p-coumaroyl alphitolic acid (CHEBI:65662) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| (2α,3β)-3-hydroxy-2-{[(2E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy}lup-20(29)-en-28-oic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10410488 | Reaxys |
| Citations |
|---|