EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H21NO5 |
| Net Charge | 0 |
| Average Mass | 367.401 |
| Monoisotopic Mass | 367.14197 |
| SMILES | [H][C@@]12c3cc4c(cc3C[C@H](O)[C@]1(C)c1ccc3c(c1CN2C)OCO3)OCO4 |
| InChI | InChI=1S/C21H21NO5/c1-21-14-3-4-15-19(27-10-24-15)13(14)8-22(2)20(21)12-7-17-16(25-9-26-17)5-11(12)6-18(21)23/h3-5,7,18,20,23H,6,8-10H2,1-2H3/t18-,20+,21-/m0/s1 |
| InChIKey | IQUGPRHKZNCHGC-TYPHKJRUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Corydalis incisa (ncbitaxon:404570) | aerial part (BTO:0001658) | PubMed (17366734) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | hepatoprotective agent Any compound that is able to prevent damage to the liver. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| corynoline (CHEBI:65660) has functional parent chelidonine (CHEBI:31389) |
| corynoline (CHEBI:65660) has role antineoplastic agent (CHEBI:35610) |
| corynoline (CHEBI:65660) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| corynoline (CHEBI:65660) has role hepatoprotective agent (CHEBI:62868) |
| corynoline (CHEBI:65660) has role metabolite (CHEBI:25212) |
| corynoline (CHEBI:65660) is a benzophenanthridine alkaloid (CHEBI:38517) |
| corynoline (CHEBI:65660) is a cyclic acetal (CHEBI:59770) |
| corynoline (CHEBI:65660) is a isoquinolines (CHEBI:24922) |
| corynoline (CHEBI:65660) is a organic heterohexacyclic compound (CHEBI:51914) |
| corynoline (CHEBI:65660) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| 13-methylchelidonine |
| Synonyms | Source |
|---|---|
| (+)-corynoline | ChEBI |
| (5bR,6S,12bR)-5b,13-dimethyl-5b,6,7,12b,13,14-hexahydro[1,3]benzodioxolo[5,6-c][1,3]dioxolo[4,5-i]phenanthridin-6-ol | ChEBI |
| (11S,13R,14R)-corynoline | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4275687 | Reaxys |
| CAS:18797-79-0 | ChemIDplus |
| Citations |
|---|