EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H31N3O4 |
| Net Charge | 0 |
| Average Mass | 437.540 |
| Monoisotopic Mass | 437.23146 |
| SMILES | [H][C@@]12CC(=O)CC[C@@]13/C=C/C(=O)NCCCCNCCCNC(=O)/C=C/c1ccc(c3c1)O2 |
| InChI | InChI=1S/C25H31N3O4/c29-19-8-10-25-11-9-24(31)27-14-2-1-12-26-13-3-15-28-23(30)7-5-18-4-6-21(20(25)16-18)32-22(25)17-19/h4-7,9,11,16,22,26H,1-3,8,10,12-15,17H2,(H,27,31)(H,28,30)/b7-5+,11-9+/t22-,25+/m1/s1 |
| InChIKey | YIWJEBPTHXRHQF-LLMLIWGDSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lunarine (CHEBI:6566) is a alkaloid fundamental parent (CHEBI:35506) |
| lunarine (CHEBI:6566) is a spermidine alkaloid (CHEBI:38524) |
| IUPAC Name |
|---|
| lunarine |
| Synonym | Source |
|---|---|
| Lunarine | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:62985 | Beilstein |
| CAS:24185-51-1 | KEGG COMPOUND |
| CAS:24185-51-1 | ChemIDplus |