EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24O2 |
| Net Charge | 0 |
| Average Mass | 236.355 |
| Monoisotopic Mass | 236.17763 |
| SMILES | C=C(C)[C@@H]1CC[C@@]2(C)C(=O)CC[C@H](C)[C@]2(O)C1 |
| InChI | InChI=1S/C15H24O2/c1-10(2)12-7-8-14(4)13(16)6-5-11(3)15(14,17)9-12/h11-12,17H,1,5-9H2,2-4H3/t11-,12+,14-,15+/m0/s1 |
| InChIKey | BMGSSZITOGSORO-MYZSUADSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cyperus articulatus (IPNI:130010-3) | rhizome (BTO:0001181) | PubMed (18234452) | |
| Cyperus corymbosus (IPNI:304212-1) | rhizome (BTO:0001181) | DOI (10.1021/np50038a023) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| corymbolone (CHEBI:65659) has role metabolite (CHEBI:25212) |
| corymbolone (CHEBI:65659) is a eudesmane sesquiterpenoid (CHEBI:62508) |
| Synonym | Source |
|---|---|
| (4S,4aR,6R,8aR)-4a-hydroxy-4,8a-dimethyl-6-prop-1-en-2-yl-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:97094-19-4 | ChemIDplus |
| Citations |
|---|