EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C61H45Cl6N7O17 |
| Net Charge | 0 |
| Average Mass | 1360.781 |
| Monoisotopic Mass | 1357.10031 |
| SMILES | CN1C(=O)[C@@H](c2cc(Cl)c(O)c(Cl)c2)NC(=O)[C@@H]2NC(=O)[C@@H](c3cc(Cl)c(O)c(Cl)c3)NC(=O)[C@H](NC(=O)C(=O)c3cc(Cl)c(O)c(Cl)c3)CC3(O)C(=O)Nc4cc(ccc43)-c3cc2cc(c3O)Oc2ccc(cc2)C[C@H]1C(=O)N[C@@H](C(=O)O)c1ccc(O)cc1 |
| InChI | InChI=1S/C61H45Cl6N7O17/c1-74-42(54(82)73-47(59(87)88)24-4-7-30(75)8-5-24)12-23-2-9-31(10-3-23)91-43-21-26-13-32(49(43)77)25-6-11-33-40(20-25)69-60(89)61(33,90)22-41(68-57(85)48(76)29-18-38(66)52(80)39(67)19-29)53(81)70-45(27-14-34(62)50(78)35(63)15-27)55(83)71-44(26)56(84)72-46(58(74)86)28-16-36(64)51(79)37(65)17-28/h2-11,13-21,41-42,44-47,75,77-80,90H,12,22H2,1H3,(H,68,85)(H,69,89)(H,70,81)(H,71,83)(H,72,84)(H,73,82)(H,87,88)/t41-,42+,44-,45-,46-,47-,61?/m1/s1 |
| InChIKey | NGSUYOQYYVLKJJ-NAZRFLCCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (11473415) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | HIV-1 integrase inhibitor An inhibitor of HIV-1 integrase, an enzyme required for the integration of the genetic material of the retrovirus into the DNA of the infected cells. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| complestatin B (CHEBI:65656) has role HIV-1 integrase inhibitor (CHEBI:67268) |
| complestatin B (CHEBI:65656) has role metabolite (CHEBI:25212) |
| complestatin B (CHEBI:65656) is a cyclic ether (CHEBI:37407) |
| complestatin B (CHEBI:65656) is a heterodetic cyclic peptide (CHEBI:24533) |
| complestatin B (CHEBI:65656) is a indoles (CHEBI:24828) |
| complestatin B (CHEBI:65656) is a organochlorine compound (CHEBI:36683) |
| complestatin B (CHEBI:65656) is a polyphenol (CHEBI:26195) |
| Synonym | Source |
|---|---|
| neuroprotectin B | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8894941 | Reaxys |
| Citations |
|---|