EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16O5 |
| Net Charge | 0 |
| Average Mass | 288.299 |
| Monoisotopic Mass | 288.09977 |
| SMILES | [H][C@@]1(c2ccc(O)cc2OC)COc2cc(O)ccc2[C@H]1O |
| InChI | InChI=1S/C16H16O5/c1-20-14-6-9(17)2-4-11(14)13-8-21-15-7-10(18)3-5-12(15)16(13)19/h2-7,13,16-19H,8H2,1H3/t13-,16+/m0/s1 |
| InChIKey | ILYFLNKVHSPXAN-XJKSGUPXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| caragana conferta (ncbitaxon:626677) | whole plant (BTO:0001461) | PubMed (19336940) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| conferol A (CHEBI:65653) has role anti-inflammatory agent (CHEBI:67079) |
| conferol A (CHEBI:65653) has role metabolite (CHEBI:25212) |
| conferol A (CHEBI:65653) is a hydroxyisoflavans (CHEBI:76250) |
| conferol A (CHEBI:65653) is a monomethoxybenzene (CHEBI:25235) |
| conferol A (CHEBI:65653) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (3R,4S)-3-(4-hydroxy-2-methoxyphenyl)-3,4-dihydro-2H-chromene-4,7-diol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19728201 | Reaxys |
| Citations |
|---|