EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16Br2O4 |
| Net Charge | 0 |
| Average Mass | 444.119 |
| Monoisotopic Mass | 441.94153 |
| SMILES | COc1cc(C/C=C\Cc2cc(O)c(Br)c(O)c2)c(O)cc1Br |
| InChI | InChI=1S/C17H16Br2O4/c1-23-16-8-11(13(20)9-12(16)18)5-3-2-4-10-6-14(21)17(19)15(22)7-10/h2-3,6-9,20-22H,4-5H2,1H3/b3-2- |
| InChIKey | NHRGNEKFTRCLID-IHWYPQMZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Colpomenia sinuosa (ncbitaxon:87236) | - | DOI (10.1021/np50097a033) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| colpol (CHEBI:65652) has role antineoplastic agent (CHEBI:35610) |
| colpol (CHEBI:65652) has role metabolite (CHEBI:25212) |
| colpol (CHEBI:65652) is a aromatic ether (CHEBI:35618) |
| colpol (CHEBI:65652) is a organobromine compound (CHEBI:37141) |
| colpol (CHEBI:65652) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 2-bromo-5-[(2Z)-4-(4-bromo-2-hydroxy-5-methoxyphenyl)but-2-en-1-yl]benzene-1,3-diol |
| Manual Xrefs | Databases |
|---|---|
| 10214132 | ChemSpider |