EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H54O9 |
| Net Charge | 0 |
| Average Mass | 618.808 |
| Monoisotopic Mass | 618.37678 |
| SMILES | [H][C@@]1(C(C)(C)O)CCC2=C(CC[C@@]3(C)[C@@]2(C)CC[C@]3([H])[C@H](C)[C@@H](C/C=C(/C)C(=O)O)OC(C)=O)[C@]1(CCC(=O)OC)COC(C)=O |
| InChI | InChI=1S/C35H54O9/c1-21(31(39)40)10-12-28(44-24(4)37)22(2)25-14-17-34(8)26-11-13-29(32(5,6)41)35(20-43-23(3)36,19-16-30(38)42-9)27(26)15-18-33(25,34)7/h10,22,25,28-29,41H,11-20H2,1-9H3,(H,39,40)/b21-10-/t22-,25+,28+,29-,33+,34-,35-/m0/s1 |
| InChIKey | NAIJFFZGPGRMSV-SGTCUYSDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma colossum (ncbitaxon:36070) | - | PubMed (18547117) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. HIV protease inhibitor An inhibitor of HIV protease, an enzyme required for production of proteins needed for viral assembly. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| colossolactone V (CHEBI:65649) has parent hydride lanostane (CHEBI:20265) |
| colossolactone V (CHEBI:65649) has role fungal metabolite (CHEBI:76946) |
| colossolactone V (CHEBI:65649) has role HIV protease inhibitor (CHEBI:35660) |
| colossolactone V (CHEBI:65649) is a acetate ester (CHEBI:47622) |
| colossolactone V (CHEBI:65649) is a dicarboxylic acid monoester (CHEBI:36244) |
| colossolactone V (CHEBI:65649) is a methyl ester (CHEBI:25248) |
| colossolactone V (CHEBI:65649) is a tertiary alcohol (CHEBI:26878) |
| colossolactone V (CHEBI:65649) is a tricyclic triterpenoid (CHEBI:52340) |
| IUPAC Name |
|---|
| (2Z,5R,6S)-5-(acetyloxy)-6-[(3R,3aR,6R,7R,9bR)-6-[(acetyloxy)methyl]-7-(2-hydroxypropan-2-yl)-6-(3-methoxy-3-oxopropyl)-3a,9b-dimethyl-2,3,3a,4,5,6,7,8,9,9b-decahydro-1H-cyclopenta[a]naphthalen-3-yl]-2-methylhept-2-enoic acid |
| Synonym | Source |
|---|---|
| (22R)-3,4-seco-19,22-diacetoxy-4-hydroxylanosta-8,24(Z)-dien-3,26-dioic acid 3-methylester | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18836351 | Reaxys |
| Citations |
|---|