EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H32O6 |
| Net Charge | 0 |
| Average Mass | 464.558 |
| Monoisotopic Mass | 464.21989 |
| SMILES | CC(C)=CCC/C(C)=C/Cc1c(O)c(O)cc2c(=O)c3c(O)c(CC=C(C)C)c(O)cc3oc12 |
| InChI | InChI=1S/C28H32O6/c1-15(2)7-6-8-17(5)10-12-19-25(31)22(30)13-20-27(33)24-23(34-28(19)20)14-21(29)18(26(24)32)11-9-16(3)4/h7,9-10,13-14,29-32H,6,8,11-12H2,1-5H3/b17-10+ |
| InChIKey | QRQRZDHZRAXLKZ-LICLKQGHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cratoxylum cochinchinense (ncbitaxon:271749) | root (BTO:0001188) | PubMed (16310231) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cochinchinone B (CHEBI:65647) has role antioxidant (CHEBI:22586) |
| cochinchinone B (CHEBI:65647) has role metabolite (CHEBI:25212) |
| cochinchinone B (CHEBI:65647) is a polyphenol (CHEBI:26195) |
| cochinchinone B (CHEBI:65647) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| 5-[(2E)-3,7-dimethylocta-2,6-dien-1-yl]-1,3,6,7-tetrahydroxy-2-(3-methylbut-2-en-1-yl)-9H-xanthen-9-one |
| Synonym | Source |
|---|---|
| 1,3,6,7-tetrahydroxy-2-(3-methyl-2-butenyl)-5-(3,7-dimethyl-2,6-octadienyl)xanthone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11075724 | Reaxys |
| Citations |
|---|