EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H32O5 |
| Net Charge | 0 |
| Average Mass | 448.559 |
| Monoisotopic Mass | 448.22497 |
| SMILES | CC(C)=CCC/C(C)=C/Cc1c(O)c(CC=C(C)C)c(O)c2c(=O)c3cc(O)ccc3oc12 |
| InChI | InChI=1S/C28H32O5/c1-16(2)7-6-8-18(5)10-13-21-25(30)20(12-9-17(3)4)26(31)24-27(32)22-15-19(29)11-14-23(22)33-28(21)24/h7,9-11,14-15,29-31H,6,8,12-13H2,1-5H3/b18-10+ |
| InChIKey | ZHJQVNDLFGICFY-VCHYOVAHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cratoxylum cochinchinense (ncbitaxon:271749) | |||
| root (BTO:0001188) | PubMed (16310231) | ||
| stem (BTO:0001300) | PubMed (21428375) | Methanolic extract of dried and ground stems |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. NF-kappaB inhibitor An inhibitor of NF-κB (nuclear factor κ-light-chain-enhancer of activated B cells), a protein complex involved in the transcription of DNA. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cochinchinone A (CHEBI:65646) has role antineoplastic agent (CHEBI:35610) |
| cochinchinone A (CHEBI:65646) has role antioxidant (CHEBI:22586) |
| cochinchinone A (CHEBI:65646) has role NF-κB inhibitor (CHEBI:73240) |
| cochinchinone A (CHEBI:65646) has role plant metabolite (CHEBI:76924) |
| cochinchinone A (CHEBI:65646) is a polyphenol (CHEBI:26195) |
| cochinchinone A (CHEBI:65646) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| 4-[(2E)-3,7-dimethylocta-2,6-dien-1-yl]-1,3,7-trihydroxy-2-(3-methylbut-2-en-1-yl)-9H-xanthen-9-one |
| Synonym | Source |
|---|---|
| 1,3,7-trihydroxy-2-(3-methyl-2-butenyl)-4-(3,7-dimethyl-2,6-octadienyl)xanthone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10399739 | Reaxys |
| Citations |
|---|