EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H17Cl3O2 |
| Net Charge | 0 |
| Average Mass | 383.702 |
| Monoisotopic Mass | 382.02941 |
| SMILES | [H][C@@]12C(=O)C=C[C@@]1(C)CCC1=C2C(=O)C=C2C=C[C@H](Cl)[C@@H](Cl)[C@@]21CCl |
| InChI | InChI=1S/C19H17Cl3O2/c1-18-6-4-11-15(16(18)13(23)5-7-18)14(24)8-10-2-3-12(21)17(22)19(10,11)9-20/h2-3,5,7-8,12,16-17H,4,6,9H2,1H3/t12-,16-,17+,18+,19-/m0/s1 |
| InChIKey | OFMUBMLCGMAWGO-GJQMJKEGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cliona nigricans (ncbitaxon:395611) | - | PubMed (15128254) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clionastatin A (CHEBI:65644) has role antineoplastic agent (CHEBI:35610) |
| clionastatin A (CHEBI:65644) has role metabolite (CHEBI:25212) |
| clionastatin A (CHEBI:65644) is a 15-oxo steroid (CHEBI:61834) |
| clionastatin A (CHEBI:65644) is a 7-oxo steroid (CHEBI:47789) |
| clionastatin A (CHEBI:65644) is a androstanoid (CHEBI:50402) |
| clionastatin A (CHEBI:65644) is a chlorinated steroid (CHEBI:77175) |
| IUPAC Name |
|---|
| (1β,2α)-1,2,19-trichloroandrosta-3,5,8,16-tetraene-7,15-dione |
| Manual Xrefs | Databases |
|---|---|
| 10480079 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9803084 | Reaxys |
| Citations |
|---|