EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H64O15S2.2Na |
| Net Charge | 0 |
| Average Mass | 883.040 |
| Monoisotopic Mass | 882.34820 |
| SMILES | [H][C@]1([C@H](C)C(OC(=O)CCC)C(OC(=O)CCC)C(CC)C(C)C)[C@@H](O)[C@H](OC(C)=O)[C@@]2([H])[C@]3([H])CCC4C[C@H](OS(=O)(=O)[O-])[C@@H](OS(=O)(=O)[O-])C[C@]4(C)[C@@]3([H])CC[C@]12C.[Na+].[Na+] |
| InChI | InChI=1S/C39H66O15S2.2Na/c1-10-13-30(41)51-35(36(25(12-3)21(4)5)52-31(42)14-11-2)22(6)32-34(43)37(50-23(7)40)33-26-16-15-24-19-28(53-55(44,45)46)29(54-56(47,48)49)20-39(24,9)27(26)17-18-38(32,33)8;;/h21-22,24-29,32-37,43H,10-20H2,1-9H3,(H,44,45,46)(H,47,48,49);;/q;2*+1/p-2/t22-,24?,25?,26+,27-,28-,29-,32-,33+,34+,35?,36?,37+,38+,39-;;/m0../s1 |
| InChIKey | HACDCFFQGRQGEQ-FYVHBMJCSA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Clathria (ncbitaxon:81539) | - | PubMed (11720531) | MeOH-EtOAc extract |
| Roles Classification |
|---|
| Biological Roles: | HIV-1 reverse transcriptase inhibitor An entity which inhibits the activity of HIV-1 reverse transcriptase. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clathsterol (CHEBI:65640) has part clathsterol(2−) (CHEBI:68597) |
| clathsterol (CHEBI:65640) has role HIV-1 reverse transcriptase inhibitor (CHEBI:53756) |
| clathsterol (CHEBI:65640) has role metabolite (CHEBI:25212) |
| clathsterol (CHEBI:65640) is a butyrate ester (CHEBI:50477) |
| clathsterol (CHEBI:65640) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| disodium (2α,3β,15α,16β,24ξ)-15-(acetyloxy)-22,23-bis(butanoyloxy)-16-hydroxystigmastane-2,3-diyl disulfate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8967792 | Reaxys |
| Citations |
|---|