EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18O2 |
| Net Charge | 0 |
| Average Mass | 230.307 |
| Monoisotopic Mass | 230.13068 |
| SMILES | [H][C@@]12Cc3c(C)coc3C(=O)[C@@]1(C)CCC=C2C |
| InChI | InChI=1S/C15H18O2/c1-9-5-4-6-15(3)12(9)7-11-10(2)8-17-13(11)14(15)16/h5,8,12H,4,6-7H2,1-3H3/t12-,15-/m0/s1 |
| InChIKey | PJUXIGJXLKHONL-WFASDCNBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chloranthus japonicus (ncbitaxon:13007) | whole plant (BTO:0001461) | PubMed (18451544) |
| Roles Classification |
|---|
| Biological Roles: | EC 2.4.1.16 (chitin synthase) inhibitor A EC 2.4.1.* (hexosyltransferase) inhibitor that inhibits the action of chitin synthase (EC 2.4.1.16). antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CJ-01 (CHEBI:65638) has role antifungal agent (CHEBI:35718) |
| CJ-01 (CHEBI:65638) has role EC 2.4.1.16 (chitin synthase) inhibitor (CHEBI:59672) |
| CJ-01 (CHEBI:65638) has role metabolite (CHEBI:25212) |
| CJ-01 (CHEBI:65638) is a aromatic ketone (CHEBI:76224) |
| CJ-01 (CHEBI:65638) is a cyclic ether (CHEBI:37407) |
| CJ-01 (CHEBI:65638) is a cyclic terpene ketone (CHEBI:36130) |
| CJ-01 (CHEBI:65638) is a enone (CHEBI:51689) |
| CJ-01 (CHEBI:65638) is a organic heterotricyclic compound (CHEBI:26979) |
| CJ-01 (CHEBI:65638) is a sesquiterpenoid (CHEBI:26658) |
| IUPAC Name |
|---|
| (4aS,8aS)-3,5,8a-trimethyl-4a,7,8,8a-tetrahydronaphtho[2,3-b]furan-9(4H)-one |
| Citations |
|---|