EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18O2 |
| Net Charge | 0 |
| Average Mass | 230.307 |
| Monoisotopic Mass | 230.13068 |
| SMILES | [H][C@@]12Cc3c(C)coc3C(=O)[C@@]1(C)CCC=C2C |
| InChI | InChI=1S/C15H18O2/c1-9-5-4-6-15(3)12(9)7-11-10(2)8-17-13(11)14(15)16/h5,8,12H,4,6-7H2,1-3H3/t12-,15-/m0/s1 |
| InChIKey | PJUXIGJXLKHONL-WFASDCNBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chloranthus japonicus (ncbitaxon:13007) | whole plant (BTO:0001461) | PubMed (18451544) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 2.4.1.16 (chitin synthase) inhibitor A EC 2.4.1.* (hexosyltransferase) inhibitor that inhibits the action of chitin synthase (EC 2.4.1.16). antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CJ-01 (CHEBI:65638) has role antifungal agent (CHEBI:35718) |
| CJ-01 (CHEBI:65638) has role EC 2.4.1.16 (chitin synthase) inhibitor (CHEBI:59672) |
| CJ-01 (CHEBI:65638) has role metabolite (CHEBI:25212) |
| CJ-01 (CHEBI:65638) is a aromatic ketone (CHEBI:76224) |
| CJ-01 (CHEBI:65638) is a cyclic ether (CHEBI:37407) |
| CJ-01 (CHEBI:65638) is a cyclic terpene ketone (CHEBI:36130) |
| CJ-01 (CHEBI:65638) is a enone (CHEBI:51689) |
| CJ-01 (CHEBI:65638) is a organic heterotricyclic compound (CHEBI:26979) |
| CJ-01 (CHEBI:65638) is a sesquiterpenoid (CHEBI:26658) |
| IUPAC Name |
|---|
| (4aS,8aS)-3,5,8a-trimethyl-4a,7,8,8a-tetrahydronaphtho[2,3-b]furan-9(4H)-one |
| Citations |
|---|